2-((4,4-bis(3-methylthiophen-2-yl)but-3-en-1-yl)(methyl)amino)-3-hydroxy-N-(4-methylbenzyl)propanamide

ID: ALA4777433

PubChem CID: 162643223

Max Phase: Preclinical

Molecular Formula: C26H32N2O2S2

Molecular Weight: 468.69

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(CNC(=O)C(CO)N(C)CCC=C(c2sccc2C)c2sccc2C)cc1

Standard InChI:  InChI=1S/C26H32N2O2S2/c1-18-7-9-21(10-8-18)16-27-26(30)23(17-29)28(4)13-5-6-22(24-19(2)11-14-31-24)25-20(3)12-15-32-25/h6-12,14-15,23,29H,5,13,16-17H2,1-4H3,(H,27,30)

Standard InChI Key:  UHDDHOAMFYMNLN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
    3.0999   -4.8166    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.9248   -4.8166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1817   -4.0325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5124   -3.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8474   -4.0325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4090   -5.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2296   -5.3993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0725   -6.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2666   -6.4040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1794   -7.2244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9327   -7.5609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4853   -6.9483    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.9666   -3.7787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6556   -5.8498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7137   -6.0673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5343   -5.9820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0183   -6.6500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8389   -6.5647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6820   -7.4033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3231   -7.2327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1754   -5.8115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9959   -5.7261    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6912   -5.1434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9867   -7.9860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1551   -4.8941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3316   -4.9761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6337   -5.5675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4565   -5.4860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7982   -4.7312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3108   -4.0570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4896   -4.1419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6189   -4.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  2  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
  3 13  1  0
  9 14  1  0
  7 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  1  0
 18 20  1  0
 18 21  1  0
 21 22  1  0
 21 23  2  0
 20 24  1  0
 22 26  1  0
 25 26  1  0
 25 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 25  1  0
 29 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4777433

    ---

Associated Targets(non-human)

Slc6a11 GABA transporter 4 (930 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Slc6a13 GABA transporter 3 (681 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Slc6a1 GABA transporter 1 (1980 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.69Molecular Weight (Monoisotopic): 468.1905AlogP: 5.17#Rotatable Bonds: 10
Polar Surface Area: 52.57Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.81CX LogP: 5.75CX LogD: 5.20
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: -0.65

References

1. Zaręba P,Gryzło B,Malawska K,Sałat K,Höfner GC,Nowaczyk A,Fijałkowski Ł,Rapacz A,Podkowa A,Furgała A,Żmudzki P,Wanner KT,Malawska B,Kulig K.  (2020)  Novel mouse GABA uptake inhibitors with enhanced inhibitory activity toward mGAT3/4 and their effect on pain threshold in mice.,  188  [PMID:31901745] [10.1016/j.ejmech.2019.111920]

Source