The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2'-(tert-butyl)-1-(2-(2-chlorophenyl)quinoline-4-carbonyl)-2'H-spiro[piperidine-4,5'-pyrano[3,2-c]pyrazol]-7'(6'H)-one ID: ALA4777434
PubChem CID: 155664265
Max Phase: Preclinical
Molecular Formula: C30H29ClN4O3
Molecular Weight: 529.04
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)n1cc2c(n1)C(=O)CC1(CCN(C(=O)c3cc(-c4ccccc4Cl)nc4ccccc34)CC1)O2
Standard InChI: InChI=1S/C30H29ClN4O3/c1-29(2,3)35-18-26-27(33-35)25(36)17-30(38-26)12-14-34(15-13-30)28(37)21-16-24(20-9-4-6-10-22(20)31)32-23-11-7-5-8-19(21)23/h4-11,16,18H,12-15,17H2,1-3H3
Standard InChI Key: KMMCVLSOZWRYOH-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
22.9102 -11.6553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9061 -10.8381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2003 -10.4353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2085 -12.0697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.7401 -11.6594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7390 -12.4789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1538 -11.6558 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.4452 -11.2505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1567 -12.4784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4462 -12.8857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4446 -13.7028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1528 -14.1136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8641 -13.7013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8621 -12.8856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0313 -12.8876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3235 -12.4791 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.0314 -13.7048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.3274 -11.6591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6237 -11.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9118 -12.4740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6199 -12.8870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1973 -9.6181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4981 -11.6624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4953 -10.8446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7166 -10.5946 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2381 -11.2579 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.7212 -11.9178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4210 -11.2608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0099 -10.5545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0149 -11.9699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6014 -11.2591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4400 -10.4362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1481 -10.0261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1460 -9.2096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4365 -8.8023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7277 -9.2174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7333 -10.0325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8566 -10.4333 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 24 1 0
23 4 1 0
5 6 2 0
6 10 1 0
9 7 1 0
7 8 2 0
8 5 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 9 2 0
6 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
16 21 1 0
18 19 1 0
19 1 1 0
1 20 1 0
20 21 1 0
3 22 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
27 23 2 0
26 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
8 32 1 0
33 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 529.04Molecular Weight (Monoisotopic): 528.1928AlogP: 6.15#Rotatable Bonds: 2Polar Surface Area: 77.32Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 1.31CX LogP: 5.01CX LogD: 5.01Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.31Np Likeness Score: -1.21
References 1. Huang T,Wu X,Yan S,Liu T,Yin X. (2021) Synthesis and in vitro evaluation of novel spiroketopyrazoles as acetyl-CoA carboxylase inhibitors and potential antitumor agents., 212 [PMID:33276990 ] [10.1016/j.ejmech.2020.113036 ]