2-[[2-(4-hydroxyanilino)-2-oxo-ethyl]sutfamoyli-N-[(4-methoxyphenyl)methylbenzamide

ID: ALA4777494

PubChem CID: 146662745

Max Phase: Preclinical

Molecular Formula: C23H23N3O6S

Molecular Weight: 469.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(CNC(=O)c2ccccc2S(=O)(=O)NCC(=O)Nc2ccc(O)cc2)cc1

Standard InChI:  InChI=1S/C23H23N3O6S/c1-32-19-12-6-16(7-13-19)14-24-23(29)20-4-2-3-5-21(20)33(30,31)25-15-22(28)26-17-8-10-18(27)11-9-17/h2-13,25,27H,14-15H2,1H3,(H,24,29)(H,26,28)

Standard InChI Key:  RQODJQXNCVFKBJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   18.8158   -7.2953    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.2870   -6.6180    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.4635   -6.5477    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.3234   -6.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3221   -7.7939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0370   -8.2068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7534   -7.7934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7505   -6.9629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0352   -6.5537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0327   -5.7287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7459   -5.3141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3170   -5.3185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.4603   -5.7227    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1732   -5.3076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8893   -5.7173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8924   -6.5423    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.6022   -5.3022    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.3182   -5.7120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3166   -6.5343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0318   -6.9440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7457   -6.5288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7399   -5.6996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0242   -5.2936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4623   -6.9377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3146   -4.4935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5988   -4.0831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5983   -3.2610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8834   -2.8507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1692   -3.2654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1743   -4.0946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8898   -4.5011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4530   -2.8560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4494   -2.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  1  3  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
  8  3  1  0
  3 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 12 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 29 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4777494

    ---

Associated Targets(Human)

Hepatocyte (2737 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 469.52Molecular Weight (Monoisotopic): 469.1308AlogP: 2.25#Rotatable Bonds: 9
Polar Surface Area: 133.83Molecular Species: NEUTRALHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.13CX Basic pKa: CX LogP: 2.05CX LogD: 2.05
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.36Np Likeness Score: -1.47

References

1. Bazan HA,Bhattacharjee S,Burgos C,Recio J,Abet V,Pahng AR,Jun B,Heap J,Ledet AJ,Gordon WC,Edwards S,Paul D,Alvarez-Builla J,Bazan NG.  (2020)  A novel pipeline of 2-(benzenesulfonamide)-N-(4-hydroxyphenyl) acetamide analgesics that lack hepatotoxicity and retain antipyresis.,  202  [PMID:32629335] [10.1016/j.ejmech.2020.112600]

Source