The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[[2-(4-hydroxyanilino)-2-oxo-ethyl]sutfamoyli-N-[(4-methoxyphenyl)methylbenzamide ID: ALA4777494
PubChem CID: 146662745
Max Phase: Preclinical
Molecular Formula: C23H23N3O6S
Molecular Weight: 469.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CNC(=O)c2ccccc2S(=O)(=O)NCC(=O)Nc2ccc(O)cc2)cc1
Standard InChI: InChI=1S/C23H23N3O6S/c1-32-19-12-6-16(7-13-19)14-24-23(29)20-4-2-3-5-21(20)33(30,31)25-15-22(28)26-17-8-10-18(27)11-9-17/h2-13,25,27H,14-15H2,1H3,(H,24,29)(H,26,28)
Standard InChI Key: RQODJQXNCVFKBJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
18.8158 -7.2953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2870 -6.6180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4635 -6.5477 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.3234 -6.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3221 -7.7939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0370 -8.2068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7534 -7.7934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7505 -6.9629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0352 -6.5537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0327 -5.7287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7459 -5.3141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3170 -5.3185 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4603 -5.7227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1732 -5.3076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8893 -5.7173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8924 -6.5423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6022 -5.3022 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.3182 -5.7120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3166 -6.5343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0318 -6.9440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7457 -6.5288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7399 -5.6996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0242 -5.2936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4623 -6.9377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3146 -4.4935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5988 -4.0831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5983 -3.2610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8834 -2.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1692 -3.2654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1743 -4.0946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8898 -4.5011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4530 -2.8560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4494 -2.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 2 0
1 3 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
9 10 1 0
10 11 2 0
10 12 1 0
8 3 1 0
3 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 24 1 0
12 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 469.52Molecular Weight (Monoisotopic): 469.1308AlogP: 2.25#Rotatable Bonds: 9Polar Surface Area: 133.83Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.13CX Basic pKa: ┄CX LogP: 2.05CX LogD: 2.05Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.36Np Likeness Score: -1.47
References 1. Bazan HA,Bhattacharjee S,Burgos C,Recio J,Abet V,Pahng AR,Jun B,Heap J,Ledet AJ,Gordon WC,Edwards S,Paul D,Alvarez-Builla J,Bazan NG. (2020) A novel pipeline of 2-(benzenesulfonamide)-N-(4-hydroxyphenyl) acetamide analgesics that lack hepatotoxicity and retain antipyresis., 202 [PMID:32629335 ] [10.1016/j.ejmech.2020.112600 ]