The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-N-(2-(Diethylamino)ethyl)-5-((6-isopropyl-2-oxoindolin-3-ylidene)methyl)-2,4-dimethyl-1H-pyrrole-3-carboxamide ID: ALA4777514
PubChem CID: 162643705
Max Phase: Preclinical
Molecular Formula: C25H34N4O2
Molecular Weight: 422.57
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCNC(=O)c1c(C)[nH]c(/C=C2\C(=O)Nc3cc(C(C)C)ccc32)c1C
Standard InChI: InChI=1S/C25H34N4O2/c1-7-29(8-2)12-11-26-25(31)23-16(5)21(27-17(23)6)14-20-19-10-9-18(15(3)4)13-22(19)28-24(20)30/h9-10,13-15,27H,7-8,11-12H2,1-6H3,(H,26,31)(H,28,30)/b20-14-
Standard InChI Key: QSAUOJQJKDYQPG-ZHZULCJRSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
28.6437 -22.7785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6425 -23.6059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3573 -24.0187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3555 -22.3658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0708 -22.7749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0711 -23.6059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8615 -23.8625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.3498 -23.1900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8611 -22.5179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1158 -21.7332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1748 -23.1897 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9233 -21.5630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4749 -22.1744 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.2268 -21.8387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1400 -21.0198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3344 -20.8495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9980 -20.0962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7525 -20.4672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5373 -20.7213 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.5802 -19.6604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.9417 -22.2505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1499 -20.1687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9347 -20.4228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5472 -19.8701 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.3321 -20.1243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9446 -19.5715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3748 -19.0633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9873 -18.5106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9277 -24.0178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2159 -23.6083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9293 -24.8463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
9 10 2 0
10 12 1 0
8 11 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 2 0
16 17 1 0
15 18 1 0
18 19 1 0
18 20 2 0
14 21 1 0
19 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
27 28 1 0
2 29 1 0
29 30 1 0
29 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 422.57Molecular Weight (Monoisotopic): 422.2682AlogP: 4.32#Rotatable Bonds: 8Polar Surface Area: 77.23Molecular Species: BASEHBA: 3HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.28CX Basic pKa: 9.04CX LogP: 4.03CX LogD: 2.38Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.55Np Likeness Score: -0.85
References 1. Matheson CJ,Casalvieri KA,Backos DS,Minhajuddin M,Jordan CT,Reigan P. (2020) Substituted oxindol-3-ylidenes as AMP-activated protein kinase (AMPK) inhibitors., 197 [PMID:32334266 ] [10.1016/j.ejmech.2020.112316 ]