(Z)-N-(2-(Diethylamino)ethyl)-5-((6-isopropyl-2-oxoindolin-3-ylidene)methyl)-2,4-dimethyl-1H-pyrrole-3-carboxamide

ID: ALA4777514

PubChem CID: 162643705

Max Phase: Preclinical

Molecular Formula: C25H34N4O2

Molecular Weight: 422.57

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN(CC)CCNC(=O)c1c(C)[nH]c(/C=C2\C(=O)Nc3cc(C(C)C)ccc32)c1C

Standard InChI:  InChI=1S/C25H34N4O2/c1-7-29(8-2)12-11-26-25(31)23-16(5)21(27-17(23)6)14-20-19-10-9-18(15(3)4)13-22(19)28-24(20)30/h9-10,13-15,27H,7-8,11-12H2,1-6H3,(H,26,31)(H,28,30)/b20-14-

Standard InChI Key:  QSAUOJQJKDYQPG-ZHZULCJRSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   28.6437  -22.7785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6425  -23.6059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3573  -24.0187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3555  -22.3658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0708  -22.7749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0711  -23.6059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8615  -23.8625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3498  -23.1900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8611  -22.5179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1158  -21.7332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1748  -23.1897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.9233  -21.5630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4749  -22.1744    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.2268  -21.8387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1400  -21.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3344  -20.8495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9980  -20.0962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7525  -20.4672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5373  -20.7213    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.5802  -19.6604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.9417  -22.2505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1499  -20.1687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9347  -20.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5472  -19.8701    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.3321  -20.1243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9446  -19.5715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3748  -19.0633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9873  -18.5106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9277  -24.0178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2159  -23.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9293  -24.8463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  9 10  2  0
 10 12  1  0
  8 11  2  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  2  0
 16 17  1  0
 15 18  1  0
 18 19  1  0
 18 20  2  0
 14 21  1  0
 19 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 24 27  1  0
 27 28  1  0
  2 29  1  0
 29 30  1  0
 29 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4777514

    ---

Associated Targets(Human)

PRKAA2 Tchem AMP-activated protein kinase, alpha-2 subunit (1328 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 422.57Molecular Weight (Monoisotopic): 422.2682AlogP: 4.32#Rotatable Bonds: 8
Polar Surface Area: 77.23Molecular Species: BASEHBA: 3HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.28CX Basic pKa: 9.04CX LogP: 4.03CX LogD: 2.38
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.55Np Likeness Score: -0.85

References

1. Matheson CJ,Casalvieri KA,Backos DS,Minhajuddin M,Jordan CT,Reigan P.  (2020)  Substituted oxindol-3-ylidenes as AMP-activated protein kinase (AMPK) inhibitors.,  197  [PMID:32334266] [10.1016/j.ejmech.2020.112316]

Source