The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(cyclopropanecarbonylamino)-4-[3-[5-(dimethylcarbamoyl)pyrazin-2-yl]-2-methoxy-anilino]-N-(trideuteriomethyl)pyridazine-3-carboxamide ID: ALA4777528
PubChem CID: 157028762
Max Phase: Preclinical
Molecular Formula: C24H26N8O4
Molecular Weight: 490.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: [2H]C([2H])([2H])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(-c2cnc(C(=O)N(C)C)cn2)c1OC
Standard InChI: InChI=1S/C24H26N8O4/c1-25-23(34)20-16(10-19(30-31-20)29-22(33)13-8-9-13)28-15-7-5-6-14(21(15)36-4)17-11-27-18(12-26-17)24(35)32(2)3/h5-7,10-13H,8-9H2,1-4H3,(H,25,34)(H2,28,29,30,33)/i1D3
Standard InChI Key: NRRHFYJBAOEEEP-FIBGUPNXSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
39.3352 -7.2226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3341 -8.0421 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.0421 -8.4511 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.7518 -8.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7489 -7.2190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0403 -6.8138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6274 -6.8142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6272 -5.9970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.9198 -7.2230 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.0379 -5.9966 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.7444 -5.5859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4512 -5.9947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1572 -5.5847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1552 -4.7666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4413 -4.3603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7382 -4.7727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0276 -4.3692 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.0217 -3.5520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4601 -8.4492 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.1672 -8.0395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8755 -8.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1659 -7.2223 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.2867 -9.1508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6942 -8.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2120 -6.8145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5044 -7.2233 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
37.2118 -5.9973 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
36.5012 -6.4055 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
41.4363 -3.5477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1430 -3.1351 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.1380 -2.3187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4271 -1.9139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7197 -2.3315 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.7282 -3.1466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4182 -1.0963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1227 -0.6822 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.7073 -0.6933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.8336 -1.0852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1163 0.1350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
7 8 2 0
7 9 1 0
6 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
16 17 1 0
17 18 1 0
4 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
23 21 1 0
24 23 1 0
21 24 1 0
9 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
15 29 1 0
35 36 1 0
35 37 2 0
32 35 1 0
36 38 1 0
36 39 1 0
M ISO 3 26 2 27 2 28 2
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.52Molecular Weight (Monoisotopic): 490.2077AlogP: 2.10#Rotatable Bonds: 8Polar Surface Area: 151.33Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: ┄HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.09CX Basic pKa: 3.35CX LogP: 1.71CX LogD: 1.71Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.43Np Likeness Score: -1.33
References 1. Liu C,Lin J,Langevine C,Smith D,Li J,Tokarski JS,Khan J,Ruzanov M,Strnad J,Zupa-Fernandez A,Cheng L,Gillooly KM,Shuster D,Zhang Y,Thankappan A,McIntyre KW,Chaudhry C,Elzinga PA,Chiney M,Chimalakonda A,Lombardo LJ,Macor JE,Carter PH,Burke JR,Weinstein DS. (2021) Discovery of BMS-986202: A Clinical Tyk2 Inhibitor that Binds to Tyk2 JH2., 64 (1.0): [PMID:33370104 ] [10.1021/acs.jmedchem.0c01698 ]