(20S,23E)-20,25-dihydroxy-3,4-secodammara-4(28),23-dienoic acid methyl ester

ID: ALA477755

PubChem CID: 44575599

Max Phase: Preclinical

Molecular Formula: C31H52O4

Molecular Weight: 488.75

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  C=C(C)[C@@H]1CC[C@]2(C)[C@H](CC[C@@H]3[C@@H]([C@@](C)(O)C/C=C/C(C)(C)O)CC[C@]32C)[C@@]1(C)CCC(=O)OC

Standard InChI:  InChI=1S/C31H52O4/c1-21(2)22-13-20-30(7)25(28(22,5)18-15-26(32)35-9)12-11-23-24(14-19-29(23,30)6)31(8,34)17-10-16-27(3,4)33/h10,16,22-25,33-34H,1,11-15,17-20H2,2-9H3/b16-10+/t22-,23+,24-,25+,28-,29+,30+,31-/m0/s1

Standard InChI Key:  LCXMNWRVOPYUAP-VMKFJFSKSA-N

Molfile:  

     RDKit          2D

 39 41  0  0  0  0  0  0  0  0999 V2000
    6.1157   -3.1427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8315   -2.7302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8315   -4.3802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5474   -3.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2591   -4.3802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9750   -3.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9750   -3.1427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9750   -2.3177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6908   -2.7302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6908   -3.5552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4713   -2.9873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9602   -2.3177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4719   -1.6521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4823   -0.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4984    0.0035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2128    0.4062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2220    1.2289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9369    1.6458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6908   -1.9052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9750   -1.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2591   -1.9052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2591   -2.7302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5474   -3.1427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5474   -2.3177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2591   -3.5552    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.2667   -1.4333    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5417   -4.7917    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4015   -2.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6867   -3.1415    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4022   -1.9046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1174   -3.9671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8308   -5.2052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6574   -0.8094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3072   -0.8326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4000   -2.3167    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.6458    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3537    0.9338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5246    2.3603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9726   -2.7284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 13 19  1  0
  9 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
  7 22  1  0
 22 23  1  0
  2 23  1  0
  4 23  1  0
 23 24  1  1
 22 25  1  6
 13 26  1  6
  1  2  1  0
  4 27  1  6
  3  4  1  0
  1 28  1  0
  4  5  1  0
 28 29  1  0
  5  6  1  0
 28 30  2  0
  6  7  1  0
  3 31  2  0
  7  8  1  1
  3 32  1  0
  7  9  1  0
 14 33  1  0
  9 10  1  6
 14 34  1  6
  9 11  1  0
 19 35  1  1
 11 12  1  0
 18 36  1  0
 13 12  1  0
 18 37  1  0
 13 14  1  0
 18 38  1  0
 14 15  1  0
 29 39  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA477755

   methyl 3-[(3S,3aR,5aR,6S,7S,9aR,9bR)-3-[(E,2S)-2,6-dihydroxy-6-methylhept-4-en-2-yl]-6,9a,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,3a,4,5,5a,7,8,9-decahydrocyclopenta[a]naphthalen-6-yl]propanoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 488.75

Molecular Weight (Monoisotopic): 488.3866

AlogP: 6.85

#Rotatable Bonds: 8

Polar Surface Area: 66.76

Molecular Species: NEUTRAL

HBA: 4

HBD: 2

#RO5 Violations: 1

HBA (Lipinski): 4

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 1

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 5.89

CX LogD: 5.89

Aromatic Rings: ┄

Heavy Atoms: 35

QED Weighted: 0.29

Np Likeness Score: 2.76

References

1. Rivero-Cruz JF, Chai HB, Kardono LB, Setyowati FM, Afriatini JJ, Riswan S, Farnsworth NR, Cordell GA, Pezzuto JM, Swanson SM, Kinghorn AD..  (2004)  Cytotoxic constituents of the twigs and leaves of Aglaia rubiginosa.,  67  (3): [PMID:15043407] [10.1021/np0304417]

Source

Source(1):

• Scientific Literature