3-Acetyl-4-morpholino-7-((4-(2-nitrophenyl)pyrimidin-2-yl)amino)-2H-chromen-2-one

ID: ALA4777619

PubChem CID: 155677664

Max Phase: Preclinical

Molecular Formula: C25H21N5O6

Molecular Weight: 487.47

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)c1c(N2CCOCC2)c2ccc(Nc3nccc(-c4ccccc4[N+](=O)[O-])n3)cc2oc1=O

Standard InChI:  InChI=1S/C25H21N5O6/c1-15(31)22-23(29-10-12-35-13-11-29)18-7-6-16(14-21(18)36-24(22)32)27-25-26-9-8-19(28-25)17-4-2-3-5-20(17)30(33)34/h2-9,14H,10-13H2,1H3,(H,26,27,28)

Standard InChI Key:  RVGBAWZNWQFUGI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   30.1521  -19.1297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1510  -19.9492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8590  -20.3582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5687  -19.9487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5658  -19.1261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8572  -18.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8588  -21.1754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1513  -21.5810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1507  -22.3974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8589  -22.8070    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5690  -22.3942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5661  -21.5791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.2781  -22.8005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.9844  -22.3896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6902  -22.7967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6798  -21.1623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9769  -21.5749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3938  -21.5684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3918  -22.3906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0989  -22.8012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8125  -22.3941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8146  -21.5719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1030  -21.1568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1039  -20.3396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.5237  -21.1658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5187  -22.8055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.2300  -21.5769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5266  -20.3486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8182  -19.9328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8210  -19.1192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1156  -18.7060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.4056  -19.1126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4011  -19.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2794  -20.3557    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.9865  -19.9460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.2807  -21.1729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 11 13  1  0
 13 14  1  0
 14 15  2  0
 15 19  1  0
 18 16  1  0
 16 17  2  0
 17 14  1  0
 18 19  2  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 22 25  1  0
 21 26  2  0
 25 27  1  0
 25 28  2  0
 24 29  1  0
 24 33  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 34 35  2  0
 34 36  1  0
  4 34  1  0
M  CHG  2  34   1  36  -1
M  END

Alternative Forms

  1. Parent:

    ALA4777619

    ---

Associated Targets(Human)

CCNT1 Tchem CDK9/cyclin T1 (2643 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK2 Tchem CDK2/Cyclin A2 (2260 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.47Molecular Weight (Monoisotopic): 487.1492AlogP: 3.94#Rotatable Bonds: 6
Polar Surface Area: 140.70Molecular Species: NEUTRALHBA: 10HBD: 1
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.57CX Basic pKa: 0.95CX LogP: 3.07CX LogD: 3.07
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.18Np Likeness Score: -1.14

References

1. Xu J,Li H,Wang X,Huang J,Li S,Liu C,Dong R,Zhu G,Duan C,Jiang F,Zhang Y,Zhu Y,Zhang T,Chen Y,Tang W,Lu T.  (2020)  Discovery of coumarin derivatives as potent and selective cyclin-dependent kinase 9 (CDK9) inhibitors with high antitumour activity.,  200  [PMID:32447197] [10.1016/j.ejmech.2020.112424]

Source