N-((R)-Carbamoylphenylmethyl)-N-[(R)-1-(3,5-difluoro-2-methylphenyl)ethyl]benzamide

ID: ALA4777635

PubChem CID: 118247067

Max Phase: Preclinical

Molecular Formula: C24H22F2N2O2

Molecular Weight: 408.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(F)cc(F)cc1[C@@H](C)N(C(=O)c1ccccc1)[C@@H](C(N)=O)c1ccccc1

Standard InChI:  InChI=1S/C24H22F2N2O2/c1-15-20(13-19(25)14-21(15)26)16(2)28(24(30)18-11-7-4-8-12-18)22(23(27)29)17-9-5-3-6-10-17/h3-14,16,22H,1-2H3,(H2,27,29)/t16-,22-/m1/s1

Standard InChI Key:  YSERDLPZFXTFNG-OPAMFIHVSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   33.9450   -1.4651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9439   -2.2888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6561   -2.7019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3699   -2.2883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3670   -1.4615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6543   -1.0563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6559   -3.5232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9439   -3.9316    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.3676   -3.9320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0795   -3.5235    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.3674   -4.7533    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.2322   -3.5229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5203   -3.9313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8118   -3.5191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1044   -3.9268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1038   -4.7490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8164   -5.1618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5249   -4.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2324   -2.7015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9437   -4.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2318   -5.1655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.5243   -5.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3113   -6.1237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8869   -6.6987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6785   -6.4874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8870   -5.6916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3099   -5.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8134   -2.7019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3970   -3.5177    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   31.8180   -5.9790    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  3  1  6
  7  8  1  0
  7  9  1  0
  9 10  1  0
  9 11  2  0
  8 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 12 19  1  1
  8 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 14 28  1  0
 15 29  1  0
 17 30  1  0
M  END

Associated Targets(Human)

TRPM8 Tclin Transient receptor potential cation channel subfamily M member 8 (1168 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NR1I2 Tchem Pregnane X receptor (6667 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 408.45Molecular Weight (Monoisotopic): 408.1649AlogP: 4.70#Rotatable Bonds: 6
Polar Surface Area: 63.40Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.82CX LogD: 4.82
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.64Np Likeness Score: -1.12

References

1. Kobayashi JI,Hirasawa H,Fujimori Y,Nakanishi O,Kamada N,Ikeda T,Yamamoto A,Kanbe H.  (2021)  Identification of N-acyl-N-indanyl-α-phenylglycinamides as selective TRPM8 antagonists designed to mitigate the risk of adverse effects.,  30  [PMID:33333445] [10.1016/j.bmc.2020.115903]

Source