The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(cyclopropanecarbonylamino)-4-(2-methoxy-3-pyrimidin-4-yl-anilino)-N-(trideuteriomethyl)pyridazine-3-carboxamide ID: ALA4777648
PubChem CID: 162644026
Max Phase: Preclinical
Molecular Formula: C21H21N7O3
Molecular Weight: 419.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: [2H]C([2H])([2H])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(-c2ccncn2)c1OC
Standard InChI: InChI=1S/C21H21N7O3/c1-22-21(30)18-16(10-17(27-28-18)26-20(29)12-6-7-12)25-15-5-3-4-13(19(15)31-2)14-8-9-23-11-24-14/h3-5,8-12H,6-7H2,1-2H3,(H,22,30)(H2,25,26,27,29)/i1D3
Standard InChI Key: FFLGDUUTRSHVAM-FIBGUPNXSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
15.8348 -5.9349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8336 -6.7545 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5417 -7.1634 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2513 -6.7540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2485 -5.9313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5399 -5.5261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1270 -5.5265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1268 -4.7093 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4193 -5.9353 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5374 -4.7089 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2439 -4.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9507 -4.7070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6567 -4.2970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6547 -3.4789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9408 -3.0726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2378 -3.4850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5271 -3.0815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5212 -2.2643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9597 -7.1615 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6667 -6.7518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3751 -7.1592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6655 -5.9346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7863 -7.8631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1937 -7.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7115 -5.5268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0039 -5.9356 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.7113 -4.7096 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.0008 -5.1178 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17.9359 -2.2600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6425 -1.8474 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6375 -1.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9266 -0.6262 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2193 -1.0438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2277 -1.8589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
7 8 2 0
7 9 1 0
6 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
16 17 1 0
17 18 1 0
4 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
23 21 1 0
24 23 1 0
21 24 1 0
9 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
15 29 1 0
M ISO 3 26 2 27 2 28 2
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.45Molecular Weight (Monoisotopic): 419.1706AlogP: 2.39#Rotatable Bonds: 7Polar Surface Area: 131.02Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.09CX Basic pKa: 3.35CX LogP: 2.54CX LogD: 2.54Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.53Np Likeness Score: -1.28
References 1. Liu C,Lin J,Langevine C,Smith D,Li J,Tokarski JS,Khan J,Ruzanov M,Strnad J,Zupa-Fernandez A,Cheng L,Gillooly KM,Shuster D,Zhang Y,Thankappan A,McIntyre KW,Chaudhry C,Elzinga PA,Chiney M,Chimalakonda A,Lombardo LJ,Macor JE,Carter PH,Burke JR,Weinstein DS. (2021) Discovery of BMS-986202: A Clinical Tyk2 Inhibitor that Binds to Tyk2 JH2., 64 (1.0): [PMID:33370104 ] [10.1021/acs.jmedchem.0c01698 ]