6-(cyclopropanecarbonylamino)-4-(2-methoxy-3-pyrimidin-4-yl-anilino)-N-(trideuteriomethyl)pyridazine-3-carboxamide

ID: ALA4777648

PubChem CID: 162644026

Max Phase: Preclinical

Molecular Formula: C21H21N7O3

Molecular Weight: 419.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  [2H]C([2H])([2H])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(-c2ccncn2)c1OC

Standard InChI:  InChI=1S/C21H21N7O3/c1-22-21(30)18-16(10-17(27-28-18)26-20(29)12-6-7-12)25-15-5-3-4-13(19(15)31-2)14-8-9-23-11-24-14/h3-5,8-12H,6-7H2,1-2H3,(H,22,30)(H2,25,26,27,29)/i1D3

Standard InChI Key:  FFLGDUUTRSHVAM-FIBGUPNXSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   15.8348   -5.9349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8336   -6.7545    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5417   -7.1634    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2513   -6.7540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2485   -5.9313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5399   -5.5261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1270   -5.5265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1268   -4.7093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4193   -5.9353    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5374   -4.7089    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2439   -4.2982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9507   -4.7070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6567   -4.2970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6547   -3.4789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9408   -3.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2378   -3.4850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5271   -3.0815    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5212   -2.2643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9597   -7.1615    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.6667   -6.7518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3751   -7.1592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6655   -5.9346    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7863   -7.8631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1937   -7.1547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7115   -5.5268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0039   -5.9356    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.7113   -4.7096    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.0008   -5.1178    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.9359   -2.2600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6425   -1.8474    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.6375   -1.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9266   -0.6262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2193   -1.0438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2277   -1.8589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  2  0
  7  9  1  0
  6 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 16 17  1  0
 17 18  1  0
  4 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 23 21  1  0
 24 23  1  0
 21 24  1  0
  9 25  1  0
 25 26  1  0
 25 27  1  0
 25 28  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 15 29  1  0
M  ISO  3  26   2  27   2  28   2
M  END

Associated Targets(Human)

TYK2 Tclin Tyrosine-protein kinase TYK2 (5029 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.45Molecular Weight (Monoisotopic): 419.1706AlogP: 2.39#Rotatable Bonds: 7
Polar Surface Area: 131.02Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.09CX Basic pKa: 3.35CX LogP: 2.54CX LogD: 2.54
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.53Np Likeness Score: -1.28

References

1. Liu C,Lin J,Langevine C,Smith D,Li J,Tokarski JS,Khan J,Ruzanov M,Strnad J,Zupa-Fernandez A,Cheng L,Gillooly KM,Shuster D,Zhang Y,Thankappan A,McIntyre KW,Chaudhry C,Elzinga PA,Chiney M,Chimalakonda A,Lombardo LJ,Macor JE,Carter PH,Burke JR,Weinstein DS.  (2021)  Discovery of BMS-986202: A Clinical Tyk2 Inhibitor that Binds to Tyk2 JH2.,  64  (1.0): [PMID:33370104] [10.1021/acs.jmedchem.0c01698]

Source