The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-[10-(2-Amino-pyridin-4-yl)-11-oxo-10,11-dihydro-5-oxa-4,10-diaza-dibenzo[a,d]cyclohepten-7-yl]-3-(4-chloro-3-trifluoromethyl-phenyl)-urea ID: ALA4777657
PubChem CID: 162644031
Max Phase: Preclinical
Molecular Formula: C25H16ClF3N6O3
Molecular Weight: 540.89
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Nc1cc(N2C(=O)c3cccnc3Oc3cc(NC(=O)Nc4ccc(Cl)c(C(F)(F)F)c4)ccc32)ccn1
Standard InChI: InChI=1S/C25H16ClF3N6O3/c26-18-5-3-13(10-17(18)25(27,28)29)33-24(37)34-14-4-6-19-20(11-14)38-22-16(2-1-8-32-22)23(36)35(19)15-7-9-31-21(30)12-15/h1-12H,(H2,30,31)(H2,33,34,37)
Standard InChI Key: VQVRSCPORIUCDA-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
19.9799 -9.1170 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.7723 -8.9024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5620 -9.6960 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.7003 -4.6212 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5286 -7.3675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5017 -6.8393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3483 -6.4257 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9575 -6.0018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9087 -6.4269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7363 -5.9787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3906 -9.3535 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0643 -6.7357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0614 -7.6672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8493 -6.9259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4758 -5.5919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9157 -4.6461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9810 -9.6575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0673 -6.8432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7770 -8.0823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3489 -5.5959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1938 -5.1818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8731 -5.1168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9996 -8.7904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9105 -5.5950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8204 -7.9809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1903 -6.8457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0283 -7.7360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5015 -7.6700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7832 -6.4225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4160 -8.2887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4740 -6.4240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0684 -5.1835 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5423 -5.3364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6300 -5.1825 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1055 -5.2884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5956 -9.0975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2078 -8.0809 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
21.4796 -9.3110 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
31 26 2 0
24 34 1 0
24 9 2 0
30 27 1 0
15 22 1 0
36 17 1 0
36 30 2 0
33 16 2 0
6 28 2 0
12 10 1 0
23 11 2 0
28 19 1 0
14 31 1 0
34 20 1 0
15 21 2 0
14 27 1 0
12 5 2 0
7 18 1 0
19 13 2 0
31 15 1 0
20 32 2 0
18 29 2 0
11 36 1 0
29 6 1 0
12 14 1 0
8 33 1 0
27 25 2 0
20 7 1 0
21 24 1 0
16 4 1 0
25 23 1 0
22 35 1 0
10 8 2 0
13 18 1 0
9 26 1 0
35 4 2 0
35 10 1 0
28 37 1 0
19 2 1 0
2 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 540.89Molecular Weight (Monoisotopic): 540.0925AlogP: 6.46#Rotatable Bonds: 3Polar Surface Area: 122.47Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.33CX Basic pKa: 5.88CX LogP: 4.67CX LogD: 4.65Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.27Np Likeness Score: -1.28
References 1. Martínez-González S,García AB,Albarrán MI,Cebriá A,Amezquita-Alves A,García-Campos FJ,Martínez-Gago J,Martínez-Torrecuadrada J,Muñoz IG,Blanco-Aparicio C,Pastor J. (2020) Pyrido[2,3-b][1,5]benzoxazepin-5(6H)-one derivatives as CDK8 inhibitors., 201 [PMID:32599324 ] [10.1016/j.ejmech.2020.112443 ]