6-Nitro-N-(4-nitrophenyl)-1H-benzo[d]imidazol-2-amine

ID: ALA4777700

PubChem CID: 162644219

Max Phase: Preclinical

Molecular Formula: C13H9N5O4

Molecular Weight: 299.25

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=[N+]([O-])c1ccc(Nc2nc3ccc([N+](=O)[O-])cc3[nH]2)cc1

Standard InChI:  InChI=1S/C13H9N5O4/c19-17(20)9-3-1-8(2-4-9)14-13-15-11-6-5-10(18(21)22)7-12(11)16-13/h1-7H,(H2,14,15,16)

Standard InChI Key:  CQGRGTWSLKBDBR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
    9.4942  -21.4318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4930  -22.2587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2075  -22.6714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2057  -21.0191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9208  -21.4281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9210  -22.2588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7111  -22.5152    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1992  -21.8431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7107  -21.1712    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.0230  -21.8456    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4375  -21.1327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7793  -21.0198    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0651  -21.4324    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7791  -20.1952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2623  -21.1394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6766  -20.4306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2700  -19.7128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4444  -19.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0254  -20.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6872  -19.0015    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2803  -18.2813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5123  -19.0039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 12 13  2  0
 12 14  1  0
  1 12  1  0
 11 15  2  0
 11 19  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 17 20  1  0
 20 21  2  0
 20 22  1  0
M  CHG  4  12   1  14  -1  20   1  22  -1
M  END

Alternative Forms

  1. Parent:

    ALA4777700

    ---

Associated Targets(Human)

RIPK1 Tchem Receptor-interacting serine/threonine-protein kinase 1 (1548 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 299.25Molecular Weight (Monoisotopic): 299.0655AlogP: 3.12#Rotatable Bonds: 4
Polar Surface Area: 126.99Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.95CX Basic pKa: 6.09CX LogP: 3.26CX LogD: 3.23
Aromatic Rings: 3Heavy Atoms: 22QED Weighted: 0.56Np Likeness Score: -1.45

References

1. Benchekroun M,Ermolenko L,Tran MQ,Vagneux A,Nedev H,Delehouzé C,Souab M,Baratte B,Josselin B,Iorga BI,Ruchaud S,Bach S,Al-Mourabit A.  (2020)  Discovery of simplified benzazole fragments derived from the marine benzosceptrin B as necroptosis inhibitors involving the receptor interacting protein Kinase-1.,  201  [PMID:32659605] [10.1016/j.ejmech.2020.112337]

Source