The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-Chlorophenyl)-5-{4-[1-(2H-tetrazol-5-yl)cyclopentyl]phenyl}pyridin-2-amine ID: ALA4777705
PubChem CID: 162644223
Max Phase: Preclinical
Molecular Formula: C23H21ClN6
Molecular Weight: 416.92
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ncc(-c2ccc(C3(c4nn[nH]n4)CCCC3)cc2)cc1-c1ccc(Cl)cc1
Standard InChI: InChI=1S/C23H21ClN6/c24-19-9-5-16(6-10-19)20-13-17(14-26-21(20)25)15-3-7-18(8-4-15)23(11-1-2-12-23)22-27-29-30-28-22/h3-10,13-14H,1-2,11-12H2,(H2,25,26)(H,27,28,29,30)
Standard InChI Key: KQBUVBWQFHWPMI-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
5.6134 -20.1648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9526 -20.6504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2103 -21.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0304 -21.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2795 -20.6432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4470 -17.7140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4459 -18.5336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1539 -18.9425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8636 -18.5331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8608 -17.7104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1521 -17.3052 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5684 -18.9398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5684 -19.7581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2759 -20.1655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9839 -19.7558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9800 -18.9344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2719 -18.5306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5669 -17.2992 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7397 -18.9419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0321 -18.5310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3245 -18.9384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3234 -19.7564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0358 -20.1654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7404 -19.7557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6928 -20.1623 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.9080 -19.7572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8226 -18.9433 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0257 -18.7737 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6181 -19.4791 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1631 -20.0847 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
9 12 1 0
10 18 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
7 19 1 0
15 25 1 0
22 1 1 0
1 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 1 0
30 26 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 416.92Molecular Weight (Monoisotopic): 416.1516AlogP: 5.02#Rotatable Bonds: 4Polar Surface Area: 93.37Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.00CX Basic pKa: 5.62CX LogP: 5.29CX LogD: 4.54Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.49Np Likeness Score: -0.63
References 1. Dow RL,Ammirati M,Bagley SW,Bhattacharya SK,Buckbinder L,Cortes C,El-Kattan AF,Ford K,Freeman GB,Guimarães CRW,Liu S,Niosi M,Skoura A,Tess D. (2018) 2-Aminopyridine-Based Mitogen-Activated Protein Kinase Kinase Kinase Kinase 4 (MAP4K4) Inhibitors: Assessment of Mechanism-Based Safety., 61 (7): [PMID:29570292 ] [10.1021/acs.jmedchem.8b00152 ]