N-(2-(diethylamino)ethyl)-1-ethyl-5-(3-(4-(3-hydroxy-3-methylbutoxy)-3-methylphenyl)pentan-3-yl)-1H-pyrrole-2-carboxamide

ID: ALA4777711

PubChem CID: 162644247

Max Phase: Preclinical

Molecular Formula: C30H49N3O3

Molecular Weight: 499.74

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(CC)CCNC(=O)c1ccc(C(CC)(CC)c2ccc(OCCC(C)(C)O)c(C)c2)n1CC

Standard InChI:  InChI=1S/C30H49N3O3/c1-9-30(10-2,24-14-16-26(23(6)22-24)36-21-18-29(7,8)35)27-17-15-25(33(27)13-5)28(34)31-19-20-32(11-3)12-4/h14-17,22,35H,9-13,18-21H2,1-8H3,(H,31,34)

Standard InChI Key:  WKIKNQXVYDVRIW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 37  0  0  0  0  0  0  0  0999 V2000
    2.0750  -11.9996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4916  -12.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9039  -11.9971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3526  -11.8913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3514  -12.7186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0662  -13.1315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7826  -12.7181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7798  -11.8876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0644  -11.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0660  -13.9565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6366  -13.1305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4927  -11.4724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2086  -11.8822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3016  -12.7012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1092  -12.8697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5191  -12.1537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9647  -11.5428    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3412  -12.0642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8286  -12.7298    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6738  -11.3093    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9039  -10.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0748  -10.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9741  -10.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0296  -10.0863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4938  -11.2198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8266  -10.4649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9225  -12.7175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2078  -13.1294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7789  -13.1283    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1334  -10.7353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9171  -10.4775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6466  -10.3756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.1341  -11.0411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9792   -9.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7994   -9.5312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9542  -10.9517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  6 10  1  0
  5 11  1  0
  8 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 13  1  0
 18 19  2  0
 18 20  1  0
 16 18  1  0
 12 21  1  0
 12 22  1  0
 22 23  1  0
 21 24  1  0
 20 25  1  0
 25 26  1  0
 11 27  1  0
 27 28  1  0
 28  2  1  0
  2 29  1  0
 17 30  1  0
 30 31  1  0
 26 32  1  0
 32 33  1  0
 32 34  1  0
 34 35  1  0
 33 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4777711

    ---

Associated Targets(Human)

VDR Tclin Vitamin D receptor (26531 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 499.74Molecular Weight (Monoisotopic): 499.3774AlogP: 5.53#Rotatable Bonds: 15
Polar Surface Area: 66.73Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.04CX LogP: 5.27CX LogD: 3.62
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.34Np Likeness Score: -0.81

References

1. Kang Z,Wang C,Tong Y,Li Y,Gao Y,Hou S,Hao M,Han X,Wang B,Wang Q,Zhang C.  (2021)  Novel Nonsecosteroidal Vitamin D Receptor Modulator Combined with Gemcitabine Enhances Pancreatic Cancer Therapy through Remodeling of the Tumor Microenvironment.,  64  (1.0): [PMID:33381963] [10.1021/acs.jmedchem.0c01197]

Source