The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N1-((S)-1-(((S)-1-(furan-2-yl)-4-methyl-1-oxopentan-2-yl)amino)-1-oxopropan-2-yl)-2-(4-methylphenylsulfonamido)-N4-neopentylsuccinamide ID: ALA4777718
PubChem CID: 162644251
Max Phase: Preclinical
Molecular Formula: C29H42N4O7S
Molecular Weight: 590.74
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(S(=O)(=O)N[C@@H](CC(=O)NCC(C)(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)c2ccco2)cc1
Standard InChI: InChI=1S/C29H42N4O7S/c1-18(2)15-22(26(35)24-9-8-14-40-24)32-27(36)20(4)31-28(37)23(16-25(34)30-17-29(5,6)7)33-41(38,39)21-12-10-19(3)11-13-21/h8-14,18,20,22-23,33H,15-17H2,1-7H3,(H,30,34)(H,31,37)(H,32,36)/t20-,22-,23-/m0/s1
Standard InChI Key: QWNJDEZPHWHFKY-PMVMPFDFSA-N
Molfile:
RDKit 2D
41 42 0 0 0 0 0 0 0 0999 V2000
3.7338 -26.2236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1486 -26.9372 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.5591 -26.2211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1773 -23.6432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9987 -23.6432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5880 -22.9318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8620 -27.3521 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5775 -26.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2931 -27.3521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0086 -26.9413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7241 -27.3521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4397 -26.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1552 -27.3521 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8666 -26.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5820 -27.3521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2976 -26.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0513 -27.2751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6051 -26.6605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1902 -25.9449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3826 -26.1200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5820 -28.1776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8666 -26.1158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4397 -26.1158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2931 -28.1776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5775 -26.1158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7165 -28.1735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2931 -25.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4393 -27.3485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7299 -26.9334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0179 -27.3416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0154 -28.1638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7308 -28.5763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4398 -28.1657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3035 -28.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0052 -26.1103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2916 -24.8795 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0022 -24.4675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7113 -23.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2791 -25.4013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8666 -24.6868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1041 -25.4013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 1 0
6 5 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 16 1 0
15 21 2 0
14 22 1 1
12 23 2 0
9 24 2 0
8 25 1 1
11 26 1 6
25 27 1 0
7 2 1 0
2 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
27 35 2 0
27 36 1 0
36 37 1 0
37 5 1 0
5 38 1 0
22 39 1 0
39 40 1 0
39 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 590.74Molecular Weight (Monoisotopic): 590.2774AlogP: 2.71#Rotatable Bonds: 14Polar Surface Area: 163.68Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.34CX Basic pKa: ┄CX LogP: 2.76CX LogD: 2.76Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.25Np Likeness Score: -0.91
References 1. Sun Q,Zhou T,Xi D,Li X,Lü Z,Xu F,Wang C,Niu Y,Xu P. (2020) Design and synthesis of tripeptidyl furylketones as selective inhibitors against the β5 subunit of human 20S proteasome., 192 [PMID:32146375 ] [10.1016/j.ejmech.2020.112160 ]