The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-amino-5-p-tolyl-3-(trifluoromethyl)-1H-pyrazol-1-yl)benzenesulfonamide hydrochloride ID: ALA4777737
PubChem CID: 162644315
Max Phase: Preclinical
Molecular Formula: C17H16ClF3N4O2S
Molecular Weight: 396.39
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-c2c(N)c(C(F)(F)F)nn2-c2ccc(S(N)(=O)=O)cc2)cc1.Cl
Standard InChI: InChI=1S/C17H15F3N4O2S.ClH/c1-10-2-4-11(5-3-10)15-14(21)16(17(18,19)20)23-24(15)12-6-8-13(9-7-12)27(22,25)26;/h2-9H,21H2,1H3,(H2,22,25,26);1H
Standard InChI Key: BYSWGQWJBYABSA-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 29 0 0 0 0 0 0 0 0999 V2000
26.0263 -20.8879 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
24.5859 -26.6702 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7976 -26.4597 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
24.0095 -27.2476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.3242 -21.8454 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.9061 -21.2676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1147 -21.0525 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.7976 -23.1909 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4606 -22.7130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2062 -21.9321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3890 -21.9321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1346 -22.7130 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.6863 -21.2708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2416 -20.5244 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
25.2360 -22.9641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4037 -23.7650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1797 -24.0188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7887 -23.4726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6165 -22.6695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8408 -22.4194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7990 -24.0104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0896 -24.4184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0893 -25.2348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7975 -25.6442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5076 -25.2312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5044 -24.4162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0914 -26.8710 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5659 -23.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 2 0
4 3 2 0
6 5 1 0
7 6 1 0
11 12 2 0
9 10 2 0
8 9 1 0
10 11 1 0
12 8 1 0
10 13 1 0
11 6 1 0
6 14 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
9 15 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
8 21 1 0
24 3 1 0
3 27 1 0
18 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 396.39Molecular Weight (Monoisotopic): 396.0868AlogP: 3.10#Rotatable Bonds: 3Polar Surface Area: 104.00Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.65CX Basic pKa: ┄CX LogP: 3.18CX LogD: 3.18Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.71Np Likeness Score: -1.55
References 1. Burgart YV,Agafonova NA,Shchegolkov EV,Krasnykh OP,Kushch SO,Evstigneeva NP,Gerasimova NA,Maslova VV,Triandafilova GA,Solodnikov SY,Ulitko MV,Makhaeva GF,Rudakova EV,Borisevich SS,Zilberberg NV,Kungurov NV,Saloutin VI,Chupakhin ON. (2020) Multiple biological active 4-aminopyrazoles containing trifluoromethyl and their 4-nitroso-precursors: Synthesis and evaluation., 208 [PMID:32932211 ] [10.1016/j.ejmech.2020.112768 ]