The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-(2-((2-((6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino)ethyl)amino)acetamido)pyridin-4-yl)-4-(cyclopropylmethoxy)-N-methylthiazole-5-carboxamide ID: ALA4777788
PubChem CID: 162643918
Max Phase: Preclinical
Molecular Formula: C31H34ClN7O3S
Molecular Weight: 620.18
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)c1sc(-c2ccnc(NC(=O)CNCCNc3c4c(nc5cc(Cl)ccc35)CCCC4)c2)nc1OCC1CC1
Standard InChI: InChI=1S/C31H34ClN7O3S/c1-33-29(41)28-30(42-17-18-6-7-18)39-31(43-28)19-10-11-35-25(14-19)38-26(40)16-34-12-13-36-27-21-4-2-3-5-23(21)37-24-15-20(32)8-9-22(24)27/h8-11,14-15,18,34H,2-7,12-13,16-17H2,1H3,(H,33,41)(H,36,37)(H,35,38,40)
Standard InChI Key: WFLNSPBNQAGFFF-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
22.9619 -15.4394 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.3675 -16.1607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1930 -16.1690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6139 -15.4568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2033 -14.7348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3791 -14.7301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9442 -16.8704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1191 -16.8587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4391 -15.4638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9162 -16.1337 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7031 -15.8854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7100 -15.0601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9273 -14.7988 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.3815 -14.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1324 -14.9226 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3020 -13.7595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.3640 -16.3774 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.1216 -16.0504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7136 -16.1398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.7836 -16.5432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1136 -17.2988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6064 -16.6369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8039 -14.4431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6979 -17.5682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8729 -17.5582 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4691 -16.8387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6439 -16.8287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2401 -16.1092 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4150 -16.0992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7675 -16.0782 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1895 -15.3682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0106 -15.3799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4294 -14.6759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0283 -13.9596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2041 -13.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7890 -14.6565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9987 -16.8069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1780 -16.8019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7655 -17.5061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1692 -18.2201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9899 -18.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4070 -17.5163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8006 -13.2334 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
4 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 9 1 0
12 14 1 0
14 15 1 0
14 16 2 0
11 17 1 0
17 18 1 0
8 19 2 0
18 20 1 0
21 20 1 0
22 21 1 0
20 22 1 0
15 23 1 0
8 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 32 2 0
31 30 2 0
30 38 1 0
37 29 1 0
31 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
37 38 2 0
37 42 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
35 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 620.18Molecular Weight (Monoisotopic): 619.2132AlogP: 5.07#Rotatable Bonds: 12Polar Surface Area: 130.16Molecular Species: NEUTRALHBA: 9HBD: 4#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.74CX Basic pKa: 8.35CX LogP: 4.57CX LogD: 3.16Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.16Np Likeness Score: -1.46
References 1. Jiang X,Zhou J,Wang Y,Chen L,Duan Y,Huang J,Liu C,Chen Y,Liu W,Sun H,Feng F,Qu W. (2020) Rational design and biological evaluation of a new class of thiazolopyridyl tetrahydroacridines as cholinesterase and GSK-3 dual inhibitors for Alzheimer's disease., 207 [PMID:32950908 ] [10.1016/j.ejmech.2020.112751 ]