The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(3',5'-di-O-acetyl-2'-deoxy-beta-D-ribofuranosyl)-5-(3-hydroxyprop-1-yn-1-yl)-6-(4-methylphenyl)-2,3-dihydrofuro[2,3-d]pyrimidin-2-one ID: ALA4777798
PubChem CID: 162643964
Max Phase: Preclinical
Molecular Formula: C25H24N2O8
Molecular Weight: 480.47
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)OC[C@H]1O[C@@H](n2cc3c(C#CCO)c(-c4ccc(C)cc4)oc3nc2=O)C[C@@H]1OC(C)=O
Standard InChI: InChI=1S/C25H24N2O8/c1-14-6-8-17(9-7-14)23-18(5-4-10-28)19-12-27(25(31)26-24(19)35-23)22-11-20(33-16(3)30)21(34-22)13-32-15(2)29/h6-9,12,20-22,28H,10-11,13H2,1-3H3/t20-,21+,22+/m0/s1
Standard InChI Key: ZWZNTCNJBPVUMU-BHDDXSALSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
5.6388 -3.7307 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3850 -4.0755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2333 -2.4403 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5593 -2.9140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9788 -2.7868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0510 -3.6005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8467 -3.7882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2703 -3.0883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7345 -2.4702 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0841 -3.0131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5540 -3.6879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3705 -3.6216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7210 -2.8781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2488 -2.1999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4311 -2.2726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8138 -2.5699 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1648 -4.5382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4812 -5.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7975 -6.0452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3032 -6.6959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5353 -2.8096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8701 -4.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6885 -4.8493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8800 -4.0494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1742 -3.6213 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5548 -4.1619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7549 -3.9767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5173 -3.1906 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7170 -3.0013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4794 -2.2152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1546 -3.6022 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4469 -5.6217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6258 -5.6046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1980 -6.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2279 -4.8846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 6 2 0
5 3 2 0
3 4 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
8 10 1 0
4 16 2 0
17 18 3 0
7 17 1 0
18 19 1 0
19 20 1 0
13 21 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 22 1 0
24 1 1 1
26 27 1 1
27 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
22 32 1 6
32 33 1 0
33 34 1 0
33 35 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.47Molecular Weight (Monoisotopic): 480.1533AlogP: 2.09#Rotatable Bonds: 5Polar Surface Area: 130.09Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.28CX Basic pKa: ┄CX LogP: 1.17CX LogD: 1.17Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.43Np Likeness Score: 0.72
References 1. Kaczmarek R,Twardy DJ,Olson TL,Korczyński D,Andrei G,Snoeck R,Dolot R,Wheeler KA,Dembinski R. (2021) Extension of furopyrimidine nucleosides with 5-alkynyl substituent: Synthesis, high fluorescence, and antiviral effect in the absence of free ribose hydroxyl groups., 209 [PMID:33039724 ] [10.1016/j.ejmech.2020.112884 ]