The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-(cyclopropanecarboxamido)pyridin-4-yl)-N-methyl-4-(2-((1-(1,2,3,4-tetrahydroacridin-9-yl)-1H-1,2,3-triazol-4-yl)methoxy)ethoxy)thiazole-5-carboxamide ID: ALA4777926
PubChem CID: 156165700
Max Phase: Preclinical
Molecular Formula: C32H32N8O4S
Molecular Weight: 624.73
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)c1sc(-c2ccnc(NC(=O)C3CC3)c2)nc1OCCOCc1cn(-c2c3c(nc4ccccc24)CCCC3)nn1
Standard InChI: InChI=1S/C32H32N8O4S/c1-33-30(42)28-31(37-32(45-28)20-12-13-34-26(16-20)36-29(41)19-10-11-19)44-15-14-43-18-21-17-40(39-38-21)27-22-6-2-4-8-24(22)35-25-9-5-3-7-23(25)27/h2,4,6,8,12-13,16-17,19H,3,5,7,9-11,14-15,18H2,1H3,(H,33,42)(H,34,36,41)
Standard InChI Key: NQJDLURKQPSDCR-UHFFFAOYSA-N
Molfile:
RDKit 2D
45 51 0 0 0 0 0 0 0 0999 V2000
1.0807 -1.9009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6486 -2.6065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0435 -3.3314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8704 -3.3519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3007 -2.6415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9033 -1.9195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6153 -4.0321 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0099 -4.7567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5797 -5.4607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8346 -4.7772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5426 -5.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5631 -4.3824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1255 -2.6585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5952 -3.3417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3850 -3.1030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4021 -2.2781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6229 -2.0071 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.0794 -1.8070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8260 -2.1581 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0100 -0.9849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0423 -3.6017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8027 -3.2817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5033 -1.6870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4601 -3.7805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2205 -3.4605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8778 -3.9592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6382 -3.6392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3420 -4.0685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9664 -3.5292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6465 -2.7687 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8245 -2.8380 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7698 -3.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3751 -4.0944 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3308 -3.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1349 -3.3056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6973 -2.7069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4611 -1.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6570 -1.7272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0891 -2.3293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8095 -4.6963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0087 -4.5072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4465 -5.1054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6839 -5.8931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4887 -6.0791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0475 -5.4794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 1 0
8 9 2 0
8 10 1 0
11 10 1 0
12 11 1 0
10 12 1 0
5 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 13 1 0
16 18 1 0
18 19 1 0
18 20 2 0
15 21 1 0
21 22 1 0
19 23 1 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 1 0
30 31 2 0
31 27 1 0
29 32 1 0
32 41 1 0
40 33 1 0
33 35 2 0
34 32 2 0
34 35 1 0
34 39 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 44 1 0
44 45 2 0
45 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 624.73Molecular Weight (Monoisotopic): 624.2267AlogP: 4.52#Rotatable Bonds: 11Polar Surface Area: 146.04Molecular Species: NEUTRALHBA: 11HBD: 2#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.93CX Basic pKa: 6.79CX LogP: 4.64CX LogD: 4.55Aromatic Rings: 5Heavy Atoms: 45QED Weighted: 0.20Np Likeness Score: -1.69
References 1. Jiang X,Zhou J,Wang Y,Chen L,Duan Y,Huang J,Liu C,Chen Y,Liu W,Sun H,Feng F,Qu W. (2020) Rational design and biological evaluation of a new class of thiazolopyridyl tetrahydroacridines as cholinesterase and GSK-3 dual inhibitors for Alzheimer's disease., 207 [PMID:32950908 ] [10.1016/j.ejmech.2020.112751 ]