2,2,2-trichloroethyl (R)-4-(6-chloro-4((5-cyclopropyl-1H-pyrazol-3-yl)amino)quinazoline-2-carbonyl)-2-methylpiperazine-1-carboxylate

ID: ALA4778224

PubChem CID: 150960703

Max Phase: Preclinical

Molecular Formula: C23H23Cl4N7O3

Molecular Weight: 587.30

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H]1CN(C(=O)c2nc(Nc3cc(C4CC4)[nH]n3)c3cc(Cl)ccc3n2)CCN1C(=O)OCC(Cl)(Cl)Cl

Standard InChI:  InChI=1S/C23H23Cl4N7O3/c1-12-10-33(6-7-34(12)22(36)37-11-23(25,26)27)21(35)20-28-16-5-4-14(24)8-15(16)19(30-20)29-18-9-17(31-32-18)13-2-3-13/h4-5,8-9,12-13H,2-3,6-7,10-11H2,1H3,(H2,28,29,30,31,32)/t12-/m1/s1

Standard InChI Key:  LMAKJYIRTTUUJR-GFCCVEGCSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   15.0671  -20.7599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0659  -21.5795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7740  -21.9884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7722  -20.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4808  -20.7563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4816  -21.5753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1901  -21.9824    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8984  -21.5716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8936  -20.7495    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1845  -20.3461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3593  -20.3515    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   17.1802  -19.5289    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8857  -19.1166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6312  -19.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1748  -18.8345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7624  -18.1289    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9640  -18.3031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.9848  -18.9127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6484  -19.3895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7295  -18.5763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6077  -21.9774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6108  -22.7946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3138  -21.5661    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.0203  -21.9757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7243  -21.5679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7254  -20.7503    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.0162  -20.3423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3061  -20.7518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4321  -21.9764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4352  -20.3389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1429  -20.7474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.4351  -19.5217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.8506  -20.3387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5583  -20.7472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2660  -20.3386    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   23.5584  -21.5644    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   24.2640  -21.1520    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  1 11  1  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 13  2  0
 19 18  1  0
 20 19  1  0
 18 20  1  0
 15 18  1  0
  8 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 25 29  1  6
 30 31  1  0
 30 32  2  0
 26 30  1  0
 31 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  1  0
 34 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4778224

    ---

Associated Targets(Human)

PAK4 Tchem Serine/threonine-protein kinase PAK 4 (3212 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 587.30Molecular Weight (Monoisotopic): 585.0616AlogP: 5.28#Rotatable Bonds: 5
Polar Surface Area: 116.34Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.18CX Basic pKa: 2.97CX LogP: 5.11CX LogD: 5.11
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.39Np Likeness Score: -1.39

References

1. Guo J,Wang T,Wu T,Zhang K,Yin W,Zhu M,Pang Y,Hao C,He Z,Cheng M,Liu Y,Zheng J,Gu J,Zhao D.  (2020)  Synthesis, bioconversion, pharmacokinetic and pharmacodynamic evaluation of N-isopropyl-oxy-carbonyloxymethyl prodrugs of CZh-226, a potent and selective PAK4 inhibitor.,  186  [PMID:31757524] [10.1016/j.ejmech.2019.111878]

Source