N-(3-(diethylamino)propyl)-1-ethyl-5-(3-(4-(6-hydroxy-6-methylheptyloxy)-3-methylphenyl)pentan-3-yl)-1H-pyrrole-2-carboxamide

ID: ALA4778261

PubChem CID: 162644009

Max Phase: Preclinical

Molecular Formula: C34H57N3O3

Molecular Weight: 555.85

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(CC)CCCNC(=O)c1ccc(C(CC)(CC)c2ccc(OCCCCCC(C)(C)O)c(C)c2)n1CC

Standard InChI:  InChI=1S/C34H57N3O3/c1-9-34(10-2,28-18-20-30(27(6)26-28)40-25-16-14-15-22-33(7,8)39)31-21-19-29(37(31)13-5)32(38)35-23-17-24-36(11-3)12-4/h18-21,26,39H,9-17,22-25H2,1-8H3,(H,35,38)

Standard InChI Key:  XZPSVULHRCKVQH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 41  0  0  0  0  0  0  0  0999 V2000
   16.8669  -13.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4586  -12.5752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0457  -13.2851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4656  -11.3418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4644  -12.1692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1793  -12.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8957  -12.1687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8928  -11.3382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1775  -10.9290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1791  -13.4071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7496  -12.5812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.6058  -10.9230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3218  -11.3327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4148  -12.1519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2224  -12.3203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6323  -11.6043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0779  -10.9933    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.4544  -11.5148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9418  -12.1804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7871  -10.7598    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.0170  -10.3335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1879  -10.3335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0872   -9.5085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1132   -9.5367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6071  -10.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9398   -9.9154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7600   -9.8261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0926   -9.0711    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.9128   -8.9817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6052   -8.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9378   -7.6505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2454   -8.2267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0354  -12.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3207  -12.5800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6065  -12.1670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8917  -12.5789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1776  -12.1658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7486  -12.1646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.2466  -10.1858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0303   -9.9281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  6 10  1  0
  5 11  1  0
  8 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 13  1  0
 18 19  2  0
 18 20  1  0
 16 18  1  0
 12 21  1  0
 12 22  1  0
 22 23  1  0
 21 24  1  0
 20 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 29 32  1  0
 11 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37  2  1  0
  2 38  1  0
 17 39  1  0
 39 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4778261

    ---

Associated Targets(Human)

VDR Tclin Vitamin D receptor (26531 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 555.85Molecular Weight (Monoisotopic): 555.4400AlogP: 7.09#Rotatable Bonds: 19
Polar Surface Area: 66.73Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.84CX LogP: 6.74CX LogD: 4.33
Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.18Np Likeness Score: -0.68

References

1. Kang Z,Wang C,Tong Y,Li Y,Gao Y,Hou S,Hao M,Han X,Wang B,Wang Q,Zhang C.  (2021)  Novel Nonsecosteroidal Vitamin D Receptor Modulator Combined with Gemcitabine Enhances Pancreatic Cancer Therapy through Remodeling of the Tumor Microenvironment.,  64  (1.0): [PMID:33381963] [10.1021/acs.jmedchem.0c01197]

Source