The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5,5'-diallyl-3-((3,4-dichlorophenyl)(piperidin-1-yl)methyl)biphenyl-2,2'-diol ID: ALA4778275
PubChem CID: 162644067
Max Phase: Preclinical
Molecular Formula: C30H31Cl2NO2
Molecular Weight: 508.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CCc1ccc(O)c(-c2cc(CC=C)cc(C(c3ccc(Cl)c(Cl)c3)N3CCCCC3)c2O)c1
Standard InChI: InChI=1S/C30H31Cl2NO2/c1-3-8-20-10-13-28(34)23(16-20)24-17-21(9-4-2)18-25(30(24)35)29(33-14-6-5-7-15-33)22-11-12-26(31)27(32)19-22/h3-4,10-13,16-19,29,34-35H,1-2,5-9,14-15H2
Standard InChI Key: KPBHHXLYLDREHO-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
33.4816 -15.7050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7432 -16.0606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6832 -16.8761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3607 -17.3368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1001 -16.9762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1566 -16.1619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7752 -17.4309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7170 -18.2471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3938 -18.7038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1291 -18.3454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1836 -17.5258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5060 -17.0727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5606 -16.2574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.8912 -15.8040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.3366 -19.5190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6020 -19.8770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5448 -20.6922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9473 -17.2315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2716 -16.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5358 -17.1275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9167 -17.1648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5959 -17.6192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5367 -18.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2150 -18.8901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9492 -18.5291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0007 -17.7093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3215 -17.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9707 -16.3493 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.7058 -15.9902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7614 -15.1784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0843 -14.7203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3494 -15.0800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2917 -15.8978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1607 -19.7055 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
39.6290 -18.9826 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
5 7 1 0
12 13 1 0
6 14 1 0
9 15 1 0
15 16 1 0
16 17 2 0
3 18 1 0
18 19 1 0
19 20 2 0
11 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
21 28 1 0
28 29 1 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
24 34 1 0
25 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.49Molecular Weight (Monoisotopic): 507.1732AlogP: 8.10#Rotatable Bonds: 8Polar Surface Area: 43.70Molecular Species: BASEHBA: 3HBD: 2#RO5 Violations: 2HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.62CX Basic pKa: 8.78CX LogP: 8.15CX LogD: 7.92Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.30Np Likeness Score: -0.03
References 1. Xu T,Zheng Z,Guo Y,Bai LP. (2020) Semisynthesis of novel magnolol-based Mannich base derivatives that suppress cancer cells via inducing autophagy., 205 [PMID:32791403 ] [10.1016/j.ejmech.2020.112663 ]