N-(3-(diethylamino)propyl)-1-ethyl-4-(3-(4-(2-hydroxy-2-phenylethoxy)-3-methylphenyl)pentan-3-yl)-1H-pyrrole-2-carboxamide

ID: ALA4778339

PubChem CID: 162644378

Max Phase: Preclinical

Molecular Formula: C34H49N3O3

Molecular Weight: 547.78

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(CC)CCCNC(=O)c1cc(C(CC)(CC)c2ccc(OCC(O)c3ccccc3)c(C)c2)cn1CC

Standard InChI:  InChI=1S/C34H49N3O3/c1-7-34(8-2,28-18-19-32(26(6)22-28)40-25-31(38)27-16-13-12-14-17-27)29-23-30(37(11-5)24-29)33(39)35-20-15-21-36(9-3)10-4/h12-14,16-19,22-24,31,38H,7-11,15,20-21,25H2,1-6H3,(H,35,39)

Standard InChI Key:  HSWGLQZCWUEGRG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 42  0  0  0  0  0  0  0  0999 V2000
   37.9729  -19.1788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9718  -20.0061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6865  -20.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4030  -20.0057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4001  -19.1752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6848  -18.7660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6863  -21.2440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2570  -20.4181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.1130  -18.7599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8290  -19.1698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9220  -19.9889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7297  -20.1573    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.1394  -19.4413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5851  -18.8303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9615  -19.3517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4490  -20.0173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.2941  -18.5968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.5243  -18.1705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6951  -18.1705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5355  -17.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5910  -17.3443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1143  -18.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.4469  -17.7524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5429  -20.0050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8281  -20.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0681  -20.9098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5856  -21.5790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.2671  -17.6631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.5997  -16.9081    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   46.4199  -16.8187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.1122  -16.2426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.4449  -15.4876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.7525  -16.0638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1140  -20.0039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8278  -21.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1114  -21.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1104  -22.4769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8251  -22.8908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5422  -22.4744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5397  -21.6516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  2  8  1  0
  5  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 10  1  0
 15 16  2  0
 15 17  1  0
 13 15  1  0
  9 18  1  0
  9 19  1  0
 19 20  1  0
 18 21  1  0
 17 22  1  0
 22 23  1  0
  8 24  1  0
 24 25  1  0
 12 26  1  0
 26 27  1  0
 23 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 30 33  1  0
 25 34  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 35  1  0
 25 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4778339

    ---

Associated Targets(Human)

VDR Tclin Vitamin D receptor (26531 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 547.78Molecular Weight (Monoisotopic): 547.3774AlogP: 6.50#Rotatable Bonds: 16
Polar Surface Area: 66.73Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.67CX Basic pKa: 9.84CX LogP: 6.44CX LogD: 4.03
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.20Np Likeness Score: -0.92

References

1. Kang Z,Wang C,Tong Y,Li Y,Gao Y,Hou S,Hao M,Han X,Wang B,Wang Q,Zhang C.  (2021)  Novel Nonsecosteroidal Vitamin D Receptor Modulator Combined with Gemcitabine Enhances Pancreatic Cancer Therapy through Remodeling of the Tumor Microenvironment.,  64  (1.0): [PMID:33381963] [10.1021/acs.jmedchem.0c01197]

Source