The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Acetyl-7-((4-(4-fluoro-2-methoxyphenyl)pyrimidin-2-yl)amino)-4-(4-methylpiperazin-1-yl)-2H-chromen-2-one ID: ALA4778363
PubChem CID: 155677579
Max Phase: Preclinical
Molecular Formula: C27H26FN5O4
Molecular Weight: 503.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(F)ccc1-c1ccnc(Nc2ccc3c(N4CCN(C)CC4)c(C(C)=O)c(=O)oc3c2)n1
Standard InChI: InChI=1S/C27H26FN5O4/c1-16(34)24-25(33-12-10-32(2)11-13-33)20-7-5-18(15-23(20)37-26(24)35)30-27-29-9-8-21(31-27)19-6-4-17(28)14-22(19)36-3/h4-9,14-15H,10-13H2,1-3H3,(H,29,30,31)
Standard InChI Key: XZKBHFRAGXAXSC-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
19.3842 -8.0976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3830 -8.9171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0911 -9.3261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8007 -8.9166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7979 -8.0940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0893 -7.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0909 -10.1433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3833 -10.5489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3828 -11.3654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0909 -11.7749 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8011 -11.3621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7981 -10.5470 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5101 -11.7684 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2165 -11.3575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9223 -11.7646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9119 -10.1302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2089 -10.5428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6259 -10.5363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6239 -11.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3309 -11.7691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0446 -11.3620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0467 -10.5398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3350 -10.1247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3359 -9.3075 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7558 -10.1337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7507 -11.7734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.4621 -10.5448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7587 -9.3165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0502 -8.9007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0531 -8.0871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3476 -7.6739 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6377 -8.0805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6331 -8.9003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0885 -6.8681 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.5131 -9.3242 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.2192 -8.9129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3516 -6.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
11 13 1 0
13 14 1 0
14 15 2 0
15 19 1 0
18 16 1 0
16 17 2 0
17 14 1 0
18 19 2 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
22 25 1 0
21 26 2 0
25 27 1 0
25 28 2 0
24 29 1 0
24 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
6 34 1 0
4 35 1 0
35 36 1 0
31 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.53Molecular Weight (Monoisotopic): 503.1969AlogP: 4.10#Rotatable Bonds: 6Polar Surface Area: 100.80Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.63CX Basic pKa: 6.54CX LogP: 3.19CX LogD: 3.13Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.31Np Likeness Score: -1.04
References 1. Xu J,Li H,Wang X,Huang J,Li S,Liu C,Dong R,Zhu G,Duan C,Jiang F,Zhang Y,Zhu Y,Zhang T,Chen Y,Tang W,Lu T. (2020) Discovery of coumarin derivatives as potent and selective cyclin-dependent kinase 9 (CDK9) inhibitors with high antitumour activity., 200 [PMID:32447197 ] [10.1016/j.ejmech.2020.112424 ]