3-Acetyl-7-((4-(4-fluoro-2-methoxyphenyl)pyrimidin-2-yl)amino)-4-(4-methylpiperazin-1-yl)-2H-chromen-2-one

ID: ALA4778363

PubChem CID: 155677579

Max Phase: Preclinical

Molecular Formula: C27H26FN5O4

Molecular Weight: 503.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(F)ccc1-c1ccnc(Nc2ccc3c(N4CCN(C)CC4)c(C(C)=O)c(=O)oc3c2)n1

Standard InChI:  InChI=1S/C27H26FN5O4/c1-16(34)24-25(33-12-10-32(2)11-13-33)20-7-5-18(15-23(20)37-26(24)35)30-27-29-9-8-21(31-27)19-6-4-17(28)14-22(19)36-3/h4-9,14-15H,10-13H2,1-3H3,(H,29,30,31)

Standard InChI Key:  XZKBHFRAGXAXSC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   19.3842   -8.0976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3830   -8.9171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0911   -9.3261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8007   -8.9166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7979   -8.0940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0893   -7.6887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0909  -10.1433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3833  -10.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3828  -11.3654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0909  -11.7749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.8011  -11.3621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7981  -10.5470    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.5101  -11.7684    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2165  -11.3575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9223  -11.7646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9119  -10.1302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2089  -10.5428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6259  -10.5363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6239  -11.3585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3309  -11.7691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.0446  -11.3620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0467  -10.5398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3350  -10.1247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3359   -9.3075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.7558  -10.1337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7507  -11.7734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.4621  -10.5448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7587   -9.3165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.0502   -8.9007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0531   -8.0871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3476   -7.6739    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.6377   -8.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6331   -8.9003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0885   -6.8681    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.5131   -9.3242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.2192   -8.9129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3516   -6.8567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 11 13  1  0
 13 14  1  0
 14 15  2  0
 15 19  1  0
 18 16  1  0
 16 17  2  0
 17 14  1  0
 18 19  2  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 22 25  1  0
 21 26  2  0
 25 27  1  0
 25 28  2  0
 24 29  1  0
 24 33  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
  6 34  1  0
  4 35  1  0
 35 36  1  0
 31 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4778363

    ---

Associated Targets(Human)

CCNT1 Tchem CDK9/cyclin T1 (2643 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK2 Tchem CDK2/Cyclin A2 (2260 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 503.53Molecular Weight (Monoisotopic): 503.1969AlogP: 4.10#Rotatable Bonds: 6
Polar Surface Area: 100.80Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.63CX Basic pKa: 6.54CX LogP: 3.19CX LogD: 3.13
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.31Np Likeness Score: -1.04

References

1. Xu J,Li H,Wang X,Huang J,Li S,Liu C,Dong R,Zhu G,Duan C,Jiang F,Zhang Y,Zhu Y,Zhang T,Chen Y,Tang W,Lu T.  (2020)  Discovery of coumarin derivatives as potent and selective cyclin-dependent kinase 9 (CDK9) inhibitors with high antitumour activity.,  200  [PMID:32447197] [10.1016/j.ejmech.2020.112424]

Source