The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,4'-Di[3-(furanyl-2-methyl)guanidino]diphenylmethane dihydrochloride ID: ALA4778444
PubChem CID: 162644276
Max Phase: Preclinical
Molecular Formula: C25H28Cl2N6O2
Molecular Weight: 442.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cl.Cl.N=C(NCc1ccco1)Nc1ccc(Cc2ccc(NC(=N)NCc3ccco3)cc2)cc1
Standard InChI: InChI=1S/C25H26N6O2.2ClH/c26-24(28-16-22-3-1-13-32-22)30-20-9-5-18(6-10-20)15-19-7-11-21(12-8-19)31-25(27)29-17-23-4-2-14-33-23;;/h1-14H,15-17H2,(H3,26,28,30)(H3,27,29,31);2*1H
Standard InChI Key: DVFABJKFAXYAJC-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
24.7205 -11.2848 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.2443 -8.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2432 -8.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9579 -9.2693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6744 -8.8560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6715 -8.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9561 -7.6163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3844 -7.6103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1005 -8.0201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1002 -8.8427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8154 -9.2524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5293 -8.8372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5235 -8.0079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8078 -7.6019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2458 -9.2461 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9581 -8.8299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5283 -9.2684 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8143 -8.8553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8149 -8.0304 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0994 -9.2673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3853 -8.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6705 -9.2662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9194 -8.9354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3669 -9.5481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7789 -10.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5859 -10.0919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6747 -9.2388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3871 -8.8227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9540 -8.0049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.1036 -9.2314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1962 -10.0470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0041 -10.2144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4129 -9.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8577 -8.8877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5402 -6.4527 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
6 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
12 15 1 0
15 16 1 0
3 17 1 0
17 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 22 1 0
16 27 1 0
27 28 1 0
16 29 2 0
28 30 1 0
30 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.52Molecular Weight (Monoisotopic): 442.2117AlogP: 4.74#Rotatable Bonds: 8Polar Surface Area: 122.10Molecular Species: BASEHBA: 4HBD: 6#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.81CX LogP: 4.14CX LogD: 1.89Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.17Np Likeness Score: -0.55
References 1. McMullan M,Kelly B,Mihigo HB,Keogh AP,Rodriguez F,Brocos-Mosquera I,García-Bea A,Miranda-Azpiazu P,Callado LF,Rozas I. (2021) Di-aryl guanidinium derivatives: Towards improved α2-Adrenergic affinity and antagonist activity., 209 [PMID:33139112 ] [10.1016/j.ejmech.2020.112947 ]