4,4'-Di[3-(furanyl-2-methyl)guanidino]diphenylmethane dihydrochloride

ID: ALA4778444

PubChem CID: 162644276

Max Phase: Preclinical

Molecular Formula: C25H28Cl2N6O2

Molecular Weight: 442.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cl.Cl.N=C(NCc1ccco1)Nc1ccc(Cc2ccc(NC(=N)NCc3ccco3)cc2)cc1

Standard InChI:  InChI=1S/C25H26N6O2.2ClH/c26-24(28-16-22-3-1-13-32-22)30-20-9-5-18(6-10-20)15-19-7-11-21(12-8-19)31-25(27)29-17-23-4-2-14-33-23;;/h1-14H,15-17H2,(H3,26,28,30)(H3,27,29,31);2*1H

Standard InChI Key:  DVFABJKFAXYAJC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 36  0  0  0  0  0  0  0  0999 V2000
   24.7205  -11.2848    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   15.2443   -8.0290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2432   -8.8565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9579   -9.2693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6744   -8.8560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6715   -8.0254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9561   -7.6163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3844   -7.6103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1005   -8.0201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1002   -8.8427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8154   -9.2524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5293   -8.8372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5235   -8.0079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8078   -7.6019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2458   -9.2461    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9581   -8.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5283   -9.2684    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.8143   -8.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8149   -8.0304    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.0994   -9.2673    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3853   -8.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6705   -9.2662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9194   -8.9354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3669   -9.5481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7789  -10.2629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5859  -10.0919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.6747   -9.2388    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3871   -8.8227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9540   -8.0049    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.1036   -9.2314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1962  -10.0470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0041  -10.2144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4129   -9.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8577   -8.8877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5402   -6.4527    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  6  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 12 15  1  0
 15 16  1  0
  3 17  1  0
 17 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 22  1  0
 16 27  1  0
 27 28  1  0
 16 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 30  2  0
M  END

Associated Targets(Human)

ADRA2A Tclin Adrenergic receptor alpha-2 (812 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 442.52Molecular Weight (Monoisotopic): 442.2117AlogP: 4.74#Rotatable Bonds: 8
Polar Surface Area: 122.10Molecular Species: BASEHBA: 4HBD: 6
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.81CX LogP: 4.14CX LogD: 1.89
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.17Np Likeness Score: -0.55

References

1. McMullan M,Kelly B,Mihigo HB,Keogh AP,Rodriguez F,Brocos-Mosquera I,García-Bea A,Miranda-Azpiazu P,Callado LF,Rozas I.  (2021)  Di-aryl guanidinium derivatives: Towards improved α2-Adrenergic affinity and antagonist activity.,  209  [PMID:33139112] [10.1016/j.ejmech.2020.112947]

Source