The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-((4-(6-(3-fluorophenyl)imidazo[2,1-b]thiazol-5-yl)pyrimidin-2-yl)amino)ethyl)-4-methylbenzenesulfonamide ID: ALA4778491
PubChem CID: 162661747
Max Phase: Preclinical
Molecular Formula: C24H21FN6O2S2
Molecular Weight: 508.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(S(=O)(=O)NCCNc2nccc(-c3c(-c4cccc(F)c4)nc4sccn34)n2)cc1
Standard InChI: InChI=1S/C24H21FN6O2S2/c1-16-5-7-19(8-6-16)35(32,33)28-12-11-27-23-26-10-9-20(29-23)22-21(17-3-2-4-18(25)15-17)30-24-31(22)13-14-34-24/h2-10,13-15,28H,11-12H2,1H3,(H,26,27,29)
Standard InChI Key: ARUHTNVJGCRCKR-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
10.2273 -5.6378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6453 -5.0559 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.4338 -5.8493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0746 -3.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0734 -4.4969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7815 -4.9058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4953 -4.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4924 -3.6696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7797 -3.2602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2005 -3.2559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9524 -3.5895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2829 -2.4388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0856 -2.2657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4954 -2.9747 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2953 -2.8067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3815 -1.9938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6348 -1.6580 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.1260 -4.3891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5208 -4.9398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6957 -5.7414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4795 -5.9934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0843 -5.4335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9063 -4.6340 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8682 -5.6779 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4739 -5.1206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3626 -3.2606 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.2578 -5.3692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8635 -4.8119 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2531 -4.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0365 -4.7514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6377 -4.1950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4597 -3.3924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6710 -3.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0690 -3.7073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0604 -2.8383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 2 0
11 14 1 0
13 12 2 0
12 10 1 0
8 10 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 13 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
11 18 1 0
22 24 1 0
24 25 1 0
4 26 1 0
25 27 1 0
27 28 1 0
28 2 1 0
2 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.60Molecular Weight (Monoisotopic): 508.1151AlogP: 4.36#Rotatable Bonds: 8Polar Surface Area: 101.28Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.40CX Basic pKa: 3.51CX LogP: 4.30CX LogD: 4.29Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.30Np Likeness Score: -2.22
References 1. Abdel-Maksoud MS,Ammar UM,Oh CH. (2019) Anticancer profile of newly synthesized BRAF inhibitors possess 5-(pyrimidin-4-yl)imidazo[2,1-b]thiazole scaffold., 27 (10.0): [PMID:30955995 ] [10.1016/j.bmc.2019.03.062 ]