6-fluoro-4-[7-[4-(4-isopropylpiperazin-1-yl)phenyl]imidazo[1,2-a]pyridin-3-yl]-2-methyl-quinoline

ID: ALA4778527

PubChem CID: 139326550

Max Phase: Preclinical

Molecular Formula: C30H30FN5

Molecular Weight: 479.60

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(-c2cnc3cc(-c4ccc(N5CCN(C(C)C)CC5)cc4)ccn23)c2cc(F)ccc2n1

Standard InChI:  InChI=1S/C30H30FN5/c1-20(2)34-12-14-35(15-13-34)25-7-4-22(5-8-25)23-10-11-36-29(19-32-30(36)17-23)27-16-21(3)33-28-9-6-24(31)18-26(27)28/h4-11,16-20H,12-15H2,1-3H3

Standard InChI Key:  KNPAYODHVLRPPC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
    9.1913  -23.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1913  -23.8430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9007  -24.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9007  -22.6090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6060  -23.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6060  -23.8395    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3840  -24.0910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8665  -23.4327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3840  -22.7703    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4807  -22.6173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4796  -21.7948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7675  -21.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0558  -21.7991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0609  -22.6247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7736  -23.0274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3423  -21.3894    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3393  -20.5649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6298  -20.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9215  -20.5676    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9230  -21.3898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6329  -21.8040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3788  -24.9078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6665  -25.3099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6610  -26.1259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3663  -26.5397    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0807  -25.3166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0779  -26.1277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7777  -26.5339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4809  -26.1302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4798  -25.3160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7793  -24.9135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9505  -26.5297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1868  -24.9062    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.2136  -20.1593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2132  -19.3421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5060  -20.5682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  1 10  1  0
 13 16  1  0
 16 17  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
  7 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 27  1  0
 26 22  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 26  2  0
 24 32  1  0
 30 33  1  0
 19 34  1  0
 34 35  1  0
 34 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4778527

    ---

Associated Targets(Human)

ACVR1 Tchem Activin receptor type-1 (1516 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 479.60Molecular Weight (Monoisotopic): 479.2485AlogP: 6.19#Rotatable Bonds: 4
Polar Surface Area: 36.67Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.42CX LogP: 5.13CX LogD: 4.07
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.31Np Likeness Score: -1.50

References

1. Engers DW,Bollinger SR,Felts AS,Vadukoot AK,Williams CH,Blobaum AL,Lindsley CW,Hong CC,Hopkins CR.  (2020)  Discovery, synthesis and characterization of a series of 7-aryl-imidazo[1,2-a]pyridine-3-ylquinolines as activin-like kinase (ALK) inhibitors.,  30  (18): [PMID:32750526] [10.1016/j.bmcl.2020.127418]

Source