N-benzyl-2-[[2-(4-hydroxyanilino)-2-oxo-ethyl]sulfamoyl]benzamide

ID: ALA4778557

PubChem CID: 146660751

Max Phase: Preclinical

Molecular Formula: C22H21N3O5S

Molecular Weight: 439.49

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CNS(=O)(=O)c1ccccc1C(=O)NCc1ccccc1)Nc1ccc(O)cc1

Standard InChI:  InChI=1S/C22H21N3O5S/c26-18-12-10-17(11-13-18)25-21(27)15-24-31(29,30)20-9-5-4-8-19(20)22(28)23-14-16-6-2-1-3-7-16/h1-13,24,26H,14-15H2,(H,23,28)(H,25,27)

Standard InChI Key:  JZWWDTIBYWFKGK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   16.9205  -24.7458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3917  -24.0685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5682  -23.9982    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.4280  -24.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4268  -25.2444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1416  -25.6572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8580  -25.2439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8552  -24.4133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1398  -24.0043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1373  -23.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8506  -22.7646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4216  -22.7688    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5650  -23.1732    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2780  -22.7579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9940  -23.1677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9971  -23.9928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7069  -22.7526    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4229  -23.1624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4214  -23.9848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1366  -24.3946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8506  -23.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8448  -23.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1290  -22.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5672  -24.3881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4192  -21.9438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7035  -21.5334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7029  -20.7113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9880  -20.3011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2738  -20.7157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2789  -21.5450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9944  -21.9516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  1  3  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
  8  3  1  0
  3 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 12 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4778557

    ---

Associated Targets(Human)

Hepatocyte (2737 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 439.49Molecular Weight (Monoisotopic): 439.1202AlogP: 2.24#Rotatable Bonds: 8
Polar Surface Area: 124.60Molecular Species: NEUTRALHBA: 5HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.13CX Basic pKa: CX LogP: 2.21CX LogD: 2.20
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.40Np Likeness Score: -1.54

References

1. Bazan HA,Bhattacharjee S,Burgos C,Recio J,Abet V,Pahng AR,Jun B,Heap J,Ledet AJ,Gordon WC,Edwards S,Paul D,Alvarez-Builla J,Bazan NG.  (2020)  A novel pipeline of 2-(benzenesulfonamide)-N-(4-hydroxyphenyl) acetamide analgesics that lack hepatotoxicity and retain antipyresis.,  202  [PMID:32629335] [10.1016/j.ejmech.2020.112600]

Source