Ethyl 4-(4-(1-(4-methoxyphenyl)-4-oxo-4,5-dihydro-1H-pyrazolo[3,4-d]pyrimidin-6-yl)phenoxy)butanoate

ID: ALA4778593

PubChem CID: 162662329

Max Phase: Preclinical

Molecular Formula: C24H24N4O5

Molecular Weight: 448.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)CCCOc1ccc(-c2nc3c(cnn3-c3ccc(OC)cc3)c(=O)[nH]2)cc1

Standard InChI:  InChI=1S/C24H24N4O5/c1-3-32-21(29)5-4-14-33-19-10-6-16(7-11-19)22-26-23-20(24(30)27-22)15-25-28(23)17-8-12-18(31-2)13-9-17/h6-13,15H,3-5,14H2,1-2H3,(H,26,27,30)

Standard InChI Key:  ZTNHKZRUERHVDP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   32.1283  -30.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1272  -31.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8425  -31.7096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5595  -31.2942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5567  -30.4637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8407  -30.0566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2671  -30.0518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9799  -30.4613    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.9686  -28.8113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2628  -29.2302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.6903  -29.2230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6932  -30.0467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4777  -30.2972    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.9614  -29.6282    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.4730  -28.9629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7355  -31.0782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1826  -31.6943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4384  -32.4776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2469  -32.6461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7990  -32.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5402  -31.2441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9626  -27.9863    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.4118  -31.7087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.6971  -31.2935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9817  -31.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2670  -31.2924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5559  -31.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8412  -31.2913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.1258  -31.7052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5551  -32.5314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.5046  -33.4254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.9585  -34.0383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4145  -31.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8 12  1  0
 11  9  1  0
  9 10  1  0
 10  7  1  0
  5  7  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 11  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 13 16  1  0
  9 22  2  0
  2 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 27 30  2  0
 19 31  1  0
 31 32  1  0
 29 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4778593

    ---

Associated Targets(non-human)

L6 (7924 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.48Molecular Weight (Monoisotopic): 448.1747AlogP: 3.51#Rotatable Bonds: 9
Polar Surface Area: 108.33Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.24CX Basic pKa: CX LogP: 2.99CX LogD: 2.99
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.31Np Likeness Score: -1.30

References

1. Gupta S,Rai AK,Pandey S,Singh LR,Kant R,Tamrakar AK,Sashidhara KV.  (2021)  Microwave-assisted efficient synthesis of pyrazole-fibrate derivatives as stimulators of glucose uptake in skeletal muscle cells.,  34  [PMID:33359606] [10.1016/j.bmcl.2020.127760]

Source