3-Acetyl-7-((4-(2-fluoro-6-methoxyphenyl)pyrimidin-2-yl)amino)-4-morpholino-2H-chromen-2-one

ID: ALA4778633

PubChem CID: 155677575

Max Phase: Preclinical

Molecular Formula: C26H23FN4O5

Molecular Weight: 490.49

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(F)c1-c1ccnc(Nc2ccc3c(N4CCOCC4)c(C(C)=O)c(=O)oc3c2)n1

Standard InChI:  InChI=1S/C26H23FN4O5/c1-15(32)22-24(31-10-12-35-13-11-31)17-7-6-16(14-21(17)36-25(22)33)29-26-28-9-8-19(30-26)23-18(27)4-3-5-20(23)34-2/h3-9,14H,10-13H2,1-2H3,(H,28,29,30)

Standard InChI Key:  RXLKGKJSOZFSEN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   10.4941   -7.6353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4930   -8.4549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2010   -8.8638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9107   -8.4544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9079   -7.6317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1992   -7.2265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2008   -9.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4933  -10.0867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4927  -10.9031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2009  -11.3127    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9110  -10.8999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9081  -10.0848    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.6201  -11.3061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3264  -10.8952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0322  -11.3024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0218   -9.6680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3189  -10.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7359  -10.0741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7338  -10.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4409  -11.3068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1546  -10.8998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1566  -10.0776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4450   -9.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4459   -8.8453    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8657   -9.6715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8607  -11.3111    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.5720  -10.0826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8686   -8.8543    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1602   -8.4385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1630   -7.6249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4576   -7.2117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7476   -7.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7431   -8.4380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6230   -8.8620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3291   -8.4506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7815   -8.8612    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 11 13  1  0
 13 14  1  0
 14 15  2  0
 15 19  1  0
 18 16  1  0
 16 17  2  0
 17 14  1  0
 18 19  2  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 22 25  1  0
 21 26  2  0
 25 27  1  0
 25 28  2  0
 24 29  1  0
 24 33  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
  4 34  1  0
 34 35  1  0
  2 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4778633

    ---

Associated Targets(Human)

CCNT1 Tchem CDK9/cyclin T1 (2643 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK2 Tchem CDK2/Cyclin A2 (2260 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 490.49Molecular Weight (Monoisotopic): 490.1652AlogP: 4.18#Rotatable Bonds: 6
Polar Surface Area: 106.79Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.56CX Basic pKa: 0.90CX LogP: 3.12CX LogD: 3.12
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.31Np Likeness Score: -1.04

References

1. Xu J,Li H,Wang X,Huang J,Li S,Liu C,Dong R,Zhu G,Duan C,Jiang F,Zhang Y,Zhu Y,Zhang T,Chen Y,Tang W,Lu T.  (2020)  Discovery of coumarin derivatives as potent and selective cyclin-dependent kinase 9 (CDK9) inhibitors with high antitumour activity.,  200  [PMID:32447197] [10.1016/j.ejmech.2020.112424]

Source