The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(1-oxo-1-(phenethylamino)-5-(piperidin-1-yl)pentan-2-yl)biphenyl-2-carboxamide ID: ALA4778746
PubChem CID: 72194631
Max Phase: Preclinical
Molecular Formula: C31H37N3O2
Molecular Weight: 483.66
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(N[C@@H](CCCN1CCCCC1)C(=O)NCCc1ccccc1)c1ccccc1-c1ccccc1
Standard InChI: InChI=1S/C31H37N3O2/c35-30(28-18-9-8-17-27(28)26-15-6-2-7-16-26)33-29(19-12-24-34-22-10-3-11-23-34)31(36)32-21-20-25-13-4-1-5-14-25/h1-2,4-9,13-18,29H,3,10-12,19-24H2,(H,32,36)(H,33,35)/t29-/m0/s1
Standard InChI Key: KBVAAQNGTAUNPZ-LJAQVGFWSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
11.7397 -12.9327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7386 -13.7600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4533 -14.1729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1698 -13.7595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1668 -12.9291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4515 -12.5199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4463 -11.6979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1611 -11.2839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1590 -10.4596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4427 -10.0485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7272 -10.4675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7328 -11.2904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8798 -12.5139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5958 -12.9237 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8766 -11.6889 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3086 -12.5085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0247 -12.9183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3055 -11.6836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0184 -11.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0153 -10.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7282 -10.0283 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4384 -10.4420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1491 -10.0303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1503 -9.2050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4344 -8.7930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7174 -9.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0277 -13.7433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7375 -12.5032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4535 -12.9130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1663 -12.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8824 -12.9075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8828 -13.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5979 -14.1393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3119 -13.7241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3060 -12.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5904 -12.4890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
6 7 1 0
5 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
16 17 1 0
16 18 1 1
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
17 27 2 0
17 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.66Molecular Weight (Monoisotopic): 483.2886AlogP: 5.08#Rotatable Bonds: 11Polar Surface Area: 61.44Molecular Species: BASEHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.94CX LogP: 5.26CX LogD: 3.71Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.40Np Likeness Score: -0.75
References 1. Nguyen T,Marusich J,Li JX,Zhang Y. (2020) Neuropeptide FF and Its Receptors: Therapeutic Applications and Ligand Development., 63 (21.0): [PMID:32673481 ] [10.1021/acs.jmedchem.0c00643 ]