(S)-N-(1-oxo-1-(phenethylamino)-5-(piperidin-1-yl)pentan-2-yl)biphenyl-2-carboxamide

ID: ALA4778746

PubChem CID: 72194631

Max Phase: Preclinical

Molecular Formula: C31H37N3O2

Molecular Weight: 483.66

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(N[C@@H](CCCN1CCCCC1)C(=O)NCCc1ccccc1)c1ccccc1-c1ccccc1

Standard InChI:  InChI=1S/C31H37N3O2/c35-30(28-18-9-8-17-27(28)26-15-6-2-7-16-26)33-29(19-12-24-34-22-10-3-11-23-34)31(36)32-21-20-25-13-4-1-5-14-25/h1-2,4-9,13-18,29H,3,10-12,19-24H2,(H,32,36)(H,33,35)/t29-/m0/s1

Standard InChI Key:  KBVAAQNGTAUNPZ-LJAQVGFWSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   11.7397  -12.9327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7386  -13.7600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4533  -14.1729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1698  -13.7595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1668  -12.9291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4515  -12.5199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4463  -11.6979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1611  -11.2839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1590  -10.4596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4427  -10.0485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7272  -10.4675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7328  -11.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8798  -12.5139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5958  -12.9237    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.8766  -11.6889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3086  -12.5085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0247  -12.9183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3055  -11.6836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0184  -11.2684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0153  -10.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7282  -10.0283    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.4384  -10.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1491  -10.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1503   -9.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4344   -8.7930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7174   -9.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0277  -13.7433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7375  -12.5032    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.4535  -12.9130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1663  -12.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8824  -12.9075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8828  -13.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5979  -14.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3119  -13.7241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3060  -12.8949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5904  -12.4890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  6  7  1  0
  5 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  1  0
 16 17  1  0
 16 18  1  1
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 17 27  2  0
 17 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
M  END

Associated Targets(Human)

NPFFR1 Tchem Neuropeptide FF receptor 1 (514 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NPFFR2 Tchem Neuropeptide FF receptor 2 (533 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.66Molecular Weight (Monoisotopic): 483.2886AlogP: 5.08#Rotatable Bonds: 11
Polar Surface Area: 61.44Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.94CX LogP: 5.26CX LogD: 3.71
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.40Np Likeness Score: -0.75

References

1. Nguyen T,Marusich J,Li JX,Zhang Y.  (2020)  Neuropeptide FF and Its Receptors: Therapeutic Applications and Ligand Development.,  63  (21.0): [PMID:32673481] [10.1021/acs.jmedchem.0c00643]

Source