2-Chloro-9-((6-(furan-2-yl)pyridin-2-yl)methyl)-9H-purin-6-amine

ID: ALA4778928

PubChem CID: 162661632

Max Phase: Preclinical

Molecular Formula: C15H11ClN6O

Molecular Weight: 326.75

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1nc(Cl)nc2c1ncn2Cc1cccc(-c2ccco2)n1

Standard InChI:  InChI=1S/C15H11ClN6O/c16-15-20-13(17)12-14(21-15)22(8-18-12)7-9-3-1-4-10(19-9)11-5-2-6-23-11/h1-6,8H,7H2,(H2,17,20,21)

Standard InChI Key:  AWNMESNEBXVLMN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 26  0  0  0  0  0  0  0  0999 V2000
   11.8043   -5.2358    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2815   -5.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7903   -6.5580    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0174   -6.2944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3056   -6.6952    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6035   -6.2788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6090   -5.4617    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3249   -5.0610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0270   -5.4773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3345   -4.2438    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0360   -7.3353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8355   -7.5154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3853   -6.9141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1849   -7.0942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4264   -7.8715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8725   -8.4728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0771   -8.2968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6311   -9.9093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1182   -9.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8911   -9.5137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8856  -10.3308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1042  -10.5765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8917   -6.6796    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  1  9  1  0
  4  9  1  0
  8 10  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 12 17  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 18 22  1  0
 16 19  1  0
 11 12  1  0
  3 11  1  0
  6 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4778928

    ---

Associated Targets(Human)

PDE8A Tclin Phosphodiesterase 8A (260 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 326.75Molecular Weight (Monoisotopic): 326.0683AlogP: 2.77#Rotatable Bonds: 3
Polar Surface Area: 95.65Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.41CX LogP: 2.28CX LogD: 2.28
Aromatic Rings: 4Heavy Atoms: 23QED Weighted: 0.58Np Likeness Score: -1.42

References

1. Huang Y,Wu XN,Zhou Q,Wu Y,Zheng D,Li Z,Guo L,Luo HB.  (2020)  Rational Design of 2-Chloroadenine Derivatives as Highly Selective Phosphodiesterase 8A Inhibitors.,  63  (24): [PMID:33291877] [10.1021/acs.jmedchem.0c01573]

Source