The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[4-[(1-bromo-2-naphthyl)oxy]-3-chloro-phenyl]-3,4-dimethoxy-benzamide ID: ALA4778943
PubChem CID: 162661938
Max Phase: Preclinical
Molecular Formula: C25H19BrClNO4
Molecular Weight: 512.79
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(=O)Nc2ccc(Oc3ccc4ccccc4c3Br)c(Cl)c2)cc1OC
Standard InChI: InChI=1S/C25H19BrClNO4/c1-30-21-10-8-16(13-23(21)31-2)25(29)28-17-9-12-20(19(27)14-17)32-22-11-7-15-5-3-4-6-18(15)24(22)26/h3-14H,1-2H3,(H,28,29)
Standard InChI Key: OOTYSNKXHDCDJJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
16.8393 -12.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5476 -12.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5428 -11.4879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8337 -11.0846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2610 -12.7242 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9712 -12.3087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6818 -12.7231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3916 -12.3083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3889 -11.4861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6705 -11.0805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9636 -11.4935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6822 -13.5444 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
21.0986 -11.0738 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8125 -11.4787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5222 -11.0665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8168 -12.3000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.2305 -11.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9397 -11.0619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9359 -10.2398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2169 -9.8309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5148 -10.2490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1238 -12.3160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1292 -11.4971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4267 -11.0853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7143 -11.4878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7089 -12.3066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4159 -12.7230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8419 -13.5463 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
24.6488 -11.4681 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6413 -9.8272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6516 -12.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6367 -9.0100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 23 1 0
2 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
7 12 1 0
9 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
15 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 15 1 0
22 23 2 0
22 27 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
1 28 1 0
18 29 1 0
19 30 1 0
29 31 1 0
30 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 512.79Molecular Weight (Monoisotopic): 511.0186AlogP: 7.32#Rotatable Bonds: 6Polar Surface Area: 56.79Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.61CX LogD: 6.61Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.29Np Likeness Score: -0.99
References 1. Fujii S,Kikuchi E,Watanabe Y,Suzuyama H,Ishigami-Yuasa M,Mori T,Isobe K,Uchida S,Kagechika H. (2020) Structural development of N-(4-phenoxyphenyl)benzamide derivatives as novel SPAK inhibitors blocking WNK kinase signaling., 30 (17): [PMID:32738993 ] [10.1016/j.bmcl.2020.127408 ]