7-((4-(4-fluoro-2-methoxyphenyl)pyrimidin-2-yl)amino)-4-morpholino-2H-chromen-2-one

ID: ALA4779055

PubChem CID: 155677585

Max Phase: Preclinical

Molecular Formula: C24H21FN4O4

Molecular Weight: 448.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(F)ccc1-c1ccnc(Nc2ccc3c(N4CCOCC4)cc(=O)oc3c2)n1

Standard InChI:  InChI=1S/C24H21FN4O4/c1-31-21-12-15(25)2-4-17(21)19-6-7-26-24(28-19)27-16-3-5-18-20(29-8-10-32-11-9-29)14-23(30)33-22(18)13-16/h2-7,12-14H,8-11H2,1H3,(H,26,27,28)

Standard InChI Key:  MDVMDFSKPQUJPQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   20.0074  -14.4494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0062  -15.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7143  -15.6779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4239  -15.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4211  -14.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7125  -14.0405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7141  -16.4951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0065  -16.9007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0060  -17.7172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7141  -18.1267    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.4243  -17.7139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4213  -16.8989    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.1333  -18.1202    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.8397  -17.7093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5455  -18.1164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5351  -16.4820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8321  -16.8946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2491  -16.8881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2471  -17.7103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9542  -18.1209    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.6678  -17.7138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6699  -16.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9583  -16.4765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9591  -15.6593    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.3739  -18.1252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.6734  -15.2525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6763  -14.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9708  -14.0257    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.2609  -14.4323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2564  -15.2521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1363  -15.6760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.8424  -15.2647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7152  -13.2220    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 11 13  1  0
 13 14  1  0
 14 15  2  0
 15 19  1  0
 18 16  1  0
 16 17  2  0
 17 14  1  0
 18 19  2  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 21 25  2  0
 24 26  1  0
 24 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
  4 31  1  0
 31 32  1  0
  6 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4779055

    ---

Associated Targets(Human)

CCNT1 Tchem CDK9/cyclin T1 (2643 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK2 Tchem CDK2/Cyclin A2 (2260 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.45Molecular Weight (Monoisotopic): 448.1547AlogP: 3.98#Rotatable Bonds: 5
Polar Surface Area: 89.72Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.72CX Basic pKa: 1.65CX LogP: 3.20CX LogD: 3.20
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.46Np Likeness Score: -1.27

References

1. Xu J,Li H,Wang X,Huang J,Li S,Liu C,Dong R,Zhu G,Duan C,Jiang F,Zhang Y,Zhu Y,Zhang T,Chen Y,Tang W,Lu T.  (2020)  Discovery of coumarin derivatives as potent and selective cyclin-dependent kinase 9 (CDK9) inhibitors with high antitumour activity.,  200  [PMID:32447197] [10.1016/j.ejmech.2020.112424]

Source