The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(4-(1-((5-cyclopropyl-1H-pyrazol-3-yl)amino)-1-oxopropan-2-yl)phenyl)cyclohexyl)acrylamide ID: ALA4779066
PubChem CID: 139558765
Max Phase: Preclinical
Molecular Formula: C24H30N4O2
Molecular Weight: 406.53
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)NC1CCC(c2ccc(C(C)C(=O)Nc3cc(C4CC4)n[nH]3)cc2)CC1
Standard InChI: InChI=1S/C24H30N4O2/c1-3-23(29)25-20-12-10-18(11-13-20)17-6-4-16(5-7-17)15(2)24(30)26-22-14-21(27-28-22)19-8-9-19/h3-7,14-15,18-20H,1,8-13H2,2H3,(H,25,29)(H2,26,27,28,30)
Standard InChI Key: OUDPXOAJUACLFI-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
12.6320 -4.2221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6309 -5.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3389 -5.4506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0486 -5.0412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0458 -4.2185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3371 -3.8133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7519 -3.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4612 -4.2132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4642 -5.0304 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1673 -3.8019 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8766 -4.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9674 -5.0196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7674 -5.1865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1733 -4.4772 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6242 -3.8720 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1036 -5.9312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0213 -6.7443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7666 -6.4091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9264 -5.4474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2278 -5.0373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5255 -5.4396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5204 -6.2530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2239 -6.6624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9324 -6.2584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7488 -2.9901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8107 -6.6581 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1050 -6.2461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3953 -6.6513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1089 -5.4290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6896 -6.2393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 2 0
8 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 11 1 0
17 16 1 0
18 17 1 0
16 18 1 0
13 16 1 0
2 19 1 0
19 20 1 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
7 25 1 0
22 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
28 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 406.53Molecular Weight (Monoisotopic): 406.2369AlogP: 4.36#Rotatable Bonds: 7Polar Surface Area: 86.88Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.76CX Basic pKa: 3.07CX LogP: 4.09CX LogD: 4.09Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.60Np Likeness Score: -0.85
References 1. (2019) Substituted Pyrazole Derivatives As Selective CDK12/13 Inhibitors, 2. (2019) Substituted Pyrazole Derivatives As Selective CDK12/13 Inhibitors,