The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-Methoxy-5-(2-methyl-5-(4-(piperazin-1-yl)phenyl)pyridin-3-yl)phenyl)methanesulfonamide ID: ALA4779127
PubChem CID: 135348481
Max Phase: Preclinical
Molecular Formula: C24H28N4O3S
Molecular Weight: 452.58
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(NS(C)(=O)=O)cc(-c2cc(-c3ccc(N4CCNCC4)cc3)cnc2C)c1
Standard InChI: InChI=1S/C24H28N4O3S/c1-17-24(19-12-21(27-32(3,29)30)15-23(13-19)31-2)14-20(16-26-17)18-4-6-22(7-5-18)28-10-8-25-9-11-28/h4-7,12-16,25,27H,8-11H2,1-3H3
Standard InChI Key: ZBGCUGHOUSPKBA-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
25.8176 -3.1420 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
26.2282 -2.4386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.4110 -2.4379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2342 -2.3236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2330 -3.1431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9411 -3.5521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6507 -3.1427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6479 -2.3200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9393 -1.9147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3591 -3.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3555 -4.3677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0630 -4.7751 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.7711 -4.3653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7672 -3.5439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0591 -3.1402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4728 -3.1317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1780 -3.5403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8831 -3.1288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8794 -2.3107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1646 -1.9059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4624 -2.3198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5844 -1.8976 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.2949 -2.3054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9978 -1.8958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9968 -1.0782 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.2866 -0.6720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5775 -1.0834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6471 -4.7751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5250 -3.5512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.9368 -1.0975 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.6433 -0.6868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1096 -3.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
1 3 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
14 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
11 28 1 0
5 29 1 0
9 30 1 0
30 31 1 0
29 1 1 0
1 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.58Molecular Weight (Monoisotopic): 452.1882AlogP: 3.51#Rotatable Bonds: 6Polar Surface Area: 83.56Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.29CX Basic pKa: 8.67CX LogP: 1.52CX LogD: 0.50Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.60Np Likeness Score: -1.18
References 1. Suebsuwong C,Dai B,Pinkas DM,Duddupudi AL,Li L,Bufton JC,Schlicher L,Gyrd-Hansen M,Hu M,Bullock AN,Degterev A,Cuny GD. (2020) Receptor-interacting protein kinase 2 (RIPK2) and nucleotide-binding oligomerization domain (NOD) cell signaling inhibitors based on a 3,5-diphenyl-2-aminopyridine scaffold., 200 [PMID:32505849 ] [10.1016/j.ejmech.2020.112417 ]