The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(diethylamino)propyl)-1-ethyl-5-(3-(4-(3-hydroxy-3-isopropyl-4-methylpentyloxy)-3-methylphenyl)pentan-3-yl)-1H-pyrrole-2-carboxamide ID: ALA4779132
PubChem CID: 162663782
Max Phase: Preclinical
Molecular Formula: C35H59N3O3
Molecular Weight: 569.88
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCCNC(=O)c1ccc(C(CC)(CC)c2ccc(OCCC(O)(C(C)C)C(C)C)c(C)c2)n1CC
Standard InChI: InChI=1S/C35H59N3O3/c1-11-34(12-2,29-17-19-31(28(10)25-29)41-24-21-35(40,26(6)7)27(8)9)32-20-18-30(38(32)15-5)33(39)36-22-16-23-37(13-3)14-4/h17-20,25-27,40H,11-16,21-24H2,1-10H3,(H,36,39)
Standard InChI Key: HWTVDQCBPHLGTI-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 42 0 0 0 0 0 0 0 0999 V2000
32.4317 -12.1612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1161 -12.6289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5284 -11.9098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9772 -11.8039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9760 -12.6313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6908 -13.0442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4073 -12.6309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4043 -11.8003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6890 -11.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6906 -13.8692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2612 -13.0432 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.1173 -11.3851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8332 -11.7950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9263 -12.6140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7340 -12.7825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1437 -12.0664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5893 -11.4555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.9658 -11.9769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4533 -12.6425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.2984 -11.2219 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.5285 -10.7956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6994 -10.7956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5397 -10.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6248 -9.9989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1186 -11.1326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4512 -10.3777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2714 -10.2882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6040 -9.5333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.4242 -9.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1165 -8.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4492 -8.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7568 -8.6889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5470 -12.6301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8323 -13.0421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4034 -13.0409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.4942 -11.3386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6880 -12.5184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3534 -11.9073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1138 -11.1966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7580 -10.6479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5417 -10.3903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
6 10 1 0
5 11 1 0
8 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 13 1 0
18 19 2 0
18 20 1 0
16 18 1 0
12 21 1 0
12 22 1 0
22 23 1 0
21 24 1 0
20 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
30 31 1 0
29 32 1 0
11 33 1 0
33 34 1 0
34 2 1 0
2 35 1 0
1 36 1 0
1 37 1 0
3 38 1 0
3 39 1 0
17 40 1 0
40 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 569.88Molecular Weight (Monoisotopic): 569.4556AlogP: 7.20#Rotatable Bonds: 18Polar Surface Area: 66.73Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.84CX LogP: 7.11CX LogD: 4.70Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.19Np Likeness Score: -0.66
References 1. Kang Z,Wang C,Tong Y,Li Y,Gao Y,Hou S,Hao M,Han X,Wang B,Wang Q,Zhang C. (2021) Novel Nonsecosteroidal Vitamin D Receptor Modulator Combined with Gemcitabine Enhances Pancreatic Cancer Therapy through Remodeling of the Tumor Microenvironment., 64 (1.0): [PMID:33381963 ] [10.1021/acs.jmedchem.0c01197 ]