N-(3-(diethylamino)propyl)-1-ethyl-5-(3-(4-(3-hydroxy-3-isopropyl-4-methylpentyloxy)-3-methylphenyl)pentan-3-yl)-1H-pyrrole-2-carboxamide

ID: ALA4779132

PubChem CID: 162663782

Max Phase: Preclinical

Molecular Formula: C35H59N3O3

Molecular Weight: 569.88

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(CC)CCCNC(=O)c1ccc(C(CC)(CC)c2ccc(OCCC(O)(C(C)C)C(C)C)c(C)c2)n1CC

Standard InChI:  InChI=1S/C35H59N3O3/c1-11-34(12-2,29-17-19-31(28(10)25-29)41-24-21-35(40,26(6)7)27(8)9)32-20-18-30(38(32)15-5)33(39)36-22-16-23-37(13-3)14-4/h17-20,25-27,40H,11-16,21-24H2,1-10H3,(H,36,39)

Standard InChI Key:  HWTVDQCBPHLGTI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 41 42  0  0  0  0  0  0  0  0999 V2000
   32.4317  -12.1612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1161  -12.6289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5284  -11.9098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9772  -11.8039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9760  -12.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6908  -13.0442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4073  -12.6309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4043  -11.8003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6890  -11.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6906  -13.8692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2612  -13.0432    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.1173  -11.3851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8332  -11.7950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9263  -12.6140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7340  -12.7825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1437  -12.0664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5893  -11.4555    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.9658  -11.9769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4533  -12.6425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.2984  -11.2219    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.5285  -10.7956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6994  -10.7956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5397  -10.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6248   -9.9989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1186  -11.1326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4512  -10.3777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2714  -10.2882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6040   -9.5333    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.4242   -9.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1165   -8.8677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4492   -8.1128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.7568   -8.6889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5470  -12.6301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8323  -13.0421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4034  -13.0409    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.4942  -11.3386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6880  -12.5184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3534  -11.9073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1138  -11.1966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7580  -10.6479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5417  -10.3903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  6 10  1  0
  5 11  1  0
  8 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 13  1  0
 18 19  2  0
 18 20  1  0
 16 18  1  0
 12 21  1  0
 12 22  1  0
 22 23  1  0
 21 24  1  0
 20 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 29 32  1  0
 11 33  1  0
 33 34  1  0
 34  2  1  0
  2 35  1  0
  1 36  1  0
  1 37  1  0
  3 38  1  0
  3 39  1  0
 17 40  1  0
 40 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4779132

    ---

Associated Targets(Human)

VDR Tclin Vitamin D receptor (26531 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 569.88Molecular Weight (Monoisotopic): 569.4556AlogP: 7.20#Rotatable Bonds: 18
Polar Surface Area: 66.73Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.84CX LogP: 7.11CX LogD: 4.70
Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.19Np Likeness Score: -0.66

References

1. Kang Z,Wang C,Tong Y,Li Y,Gao Y,Hou S,Hao M,Han X,Wang B,Wang Q,Zhang C.  (2021)  Novel Nonsecosteroidal Vitamin D Receptor Modulator Combined with Gemcitabine Enhances Pancreatic Cancer Therapy through Remodeling of the Tumor Microenvironment.,  64  (1.0): [PMID:33381963] [10.1021/acs.jmedchem.0c01197]

Source