(Z)-5-(2-ethyl-2-(6-(1-ethyl-4-fluoro-1H-indazol-6-yl)-2-oxo-1,2-dihydropyridin-3-yl)butylidene)oxazolidine-2,4-dione

ID: ALA4779295

PubChem CID: 137477676

Max Phase: Preclinical

Molecular Formula: C23H23FN4O4

Molecular Weight: 438.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCn1ncc2c(F)cc(-c3ccc(C(/C=C4\OC(=O)NC4=O)(CC)CC)c(=O)[nH]3)cc21

Standard InChI:  InChI=1S/C23H23FN4O4/c1-4-23(5-2,11-19-21(30)27-22(31)32-19)15-7-8-17(26-20(15)29)13-9-16(24)14-12-25-28(6-3)18(14)10-13/h7-12H,4-6H2,1-3H3,(H,26,29)(H,27,30,31)/b19-11-

Standard InChI Key:  JGICHSCEUBYAPA-ODLFYWEKSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   14.5980  -11.5769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0107  -10.8711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1395  -11.0234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7247  -11.2797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7247  -12.0969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4300  -12.5014    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1353  -12.0969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1353  -11.2797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4300  -10.8670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0176  -12.5065    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.8406  -12.5055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8381  -13.3238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5444  -13.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5453  -12.0984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0083  -10.0533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2979   -9.6494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2028   -8.8391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4024   -8.6745    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9984   -9.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5493   -9.9885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1863   -9.4758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8050   -8.2866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3970  -10.6482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7808  -11.5723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2534  -12.4968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2510  -13.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0379  -13.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5267  -12.9146    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.0418  -12.2432    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.2965  -11.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0964  -11.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5437  -14.5505    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  4  9  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  4  2  1  0
  5 10  2  0
 11 12  2  0
 12 13  1  0
 13 26  2  0
 25 14  2  0
 14 11  1  0
  7 11  1  0
  2 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 16  1  0
 19 21  2  0
 17 22  2  0
  3 23  1  0
  1 24  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 25  1  0
 29 30  1  0
 30 31  1  0
 13 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4779295

    ---

Associated Targets(Human)

PTGER3 Tclin Prostanoid EP3 receptor (1985 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 438.46Molecular Weight (Monoisotopic): 438.1703AlogP: 3.76#Rotatable Bonds: 6
Polar Surface Area: 106.08Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 6.15CX Basic pKa: 1.06CX LogP: 2.41CX LogD: 1.22
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.57Np Likeness Score: -0.95

References

1. Zhang X,Zhu B,Guo L,Bakaj I,Rankin M,Ho G,Kauffman J,Lee SP,Norquay L,Macielag MJ.  (2021)  Discovery of a Novel Series of Pyridone-Based EP3 Antagonists for the Treatment of Type 2 Diabetes.,  12  (3): [PMID:33738072] [10.1021/acsmedchemlett.0c00667]

Source