1-tert-butyl-3-(quinolin-5-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine

ID: ALA4779371

PubChem CID: 162663350

Max Phase: Preclinical

Molecular Formula: C18H18N6

Molecular Weight: 318.38

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)n1nc(-c2cccc3ncccc23)c2c(N)ncnc21

Standard InChI:  InChI=1S/C18H18N6/c1-18(2,3)24-17-14(16(19)21-10-22-17)15(23-24)12-6-4-8-13-11(12)7-5-9-20-13/h4-10H,1-3H3,(H2,19,21,22)

Standard InChI Key:  PHOIRSBYDPLYAL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 27  0  0  0  0  0  0  0  0999 V2000
   35.8986  -13.2773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1103  -13.4919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6903  -14.0673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6532  -11.6511    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.6521  -12.4707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3601  -12.8796    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.3583  -11.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8537  -12.7176    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.3325  -12.0508    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.8462  -11.3895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0669  -11.6475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0715  -12.4684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3559  -10.4251    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5672  -14.1038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0909  -10.6136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5884   -9.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7865   -9.2352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5420  -10.0128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1389   -9.6624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8880  -10.4392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4348  -11.0428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2325  -10.8709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4805  -10.0899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9321   -9.4897    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6 12  2  0
 11  7  2  0
  7  4  1  0
 11 12  1  0
  9 10  2  0
  8  9  1  0
 10 11  1  0
 12  8  1  0
  7 13  1  0
  8  2  1  0
  2 14  1  0
 15 20  2  0
 19 16  2  0
 16 17  1  0
 17 18  2  0
 18 15  1  0
 10 15  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4779371

    ---

Associated Targets(Human)

PRKD2 Tchem Serine/threonine-protein kinase D2 (2847 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 318.38Molecular Weight (Monoisotopic): 318.1593AlogP: 3.38#Rotatable Bonds: 1
Polar Surface Area: 82.51Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.31CX LogP: 2.87CX LogD: 2.87
Aromatic Rings: 4Heavy Atoms: 24QED Weighted: 0.58Np Likeness Score: -0.89

References

1. Gilles P,Kashyap RS,Freitas MJ,Ceusters S,Van Asch K,Janssens A,De Jonghe S,Persoons L,Cobbaut M,Daelemans D,Van Lint J,Voet ARD,De Borggraeve WM.  (2020)  Design, synthesis and biological evaluation of pyrazolo[3,4-d]pyrimidine-based protein kinase D inhibitors.,  205  [PMID:32835918] [10.1016/j.ejmech.2020.112638]

Source