The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4779431
PubChem CID: 162662581
Max Phase: Preclinical
Molecular Formula: C37H39ClN2O5
Molecular Weight: 627.18
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c3cc1Oc1c(OC)c(OC)cc4c1C(Cc1ccc(Cl)c(c1)Oc1ccc(cc1)CC3N(C)CC2)N(C)CC4
Standard InChI: InChI=1S/C37H39ClN2O5/c1-39-14-12-24-19-32(41-3)33-21-27(24)29(39)16-22-6-9-26(10-7-22)44-31-18-23(8-11-28(31)38)17-30-35-25(13-15-40(30)2)20-34(42-4)36(43-5)37(35)45-33/h6-11,18-21,29-30H,12-17H2,1-5H3
Standard InChI Key: CYBHKSCYHANSGU-UHFFFAOYSA-N
Molfile:
RDKit 2D
45 51 0 0 0 0 0 0 0 0999 V2000
9.6010 -10.0998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4527 -14.4757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3893 -12.5907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0392 -10.9211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7692 -12.6063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8103 -14.0794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1934 -10.1187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1015 -15.3114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7585 -11.3359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0546 -12.1919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7650 -14.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3292 -12.1620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1037 -14.4850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3250 -11.3391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8150 -15.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7684 -10.9572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2913 -12.6216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9686 -14.0626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0437 -13.4021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3407 -10.9509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6292 -12.1937 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9018 -12.5926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2895 -13.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0091 -15.0284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5363 -15.3109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1960 -10.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6292 -11.3665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4769 -12.5758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0355 -10.0939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4746 -13.4049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7542 -14.6432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6050 -10.9270 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6563 -13.7109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4817 -12.1922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7476 -9.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7588 -12.1639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5349 -14.4859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0562 -11.3665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3208 -15.3795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4793 -11.3638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0275 -12.6100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7560 -13.8160 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4538 -13.5440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8133 -16.5401 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.2014 -13.3718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40 26 1 0
17 23 1 0
42 31 1 0
36 9 2 0
19 45 1 0
13 6 2 0
9 4 1 0
8 39 1 0
38 10 2 0
11 18 2 0
24 11 1 0
33 43 2 0
14 32 1 0
10 5 1 0
14 12 1 0
15 44 1 0
34 40 1 0
4 29 1 0
5 34 2 0
26 7 1 0
36 28 1 0
19 42 1 0
41 19 1 0
27 21 1 0
30 28 1 0
33 23 1 0
12 41 2 0
42 30 1 0
21 17 1 0
33 2 1 0
40 16 2 0
34 3 1 0
45 6 1 0
15 25 1 0
32 1 1 0
21 22 1 0
36 41 1 0
16 38 1 0
29 35 1 0
3 12 1 0
39 11 1 0
2 24 2 0
37 6 1 0
25 37 2 0
38 20 1 0
18 43 1 0
8 15 2 0
27 20 1 0
4 14 2 0
17 10 1 0
13 8 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 627.18Molecular Weight (Monoisotopic): 626.2548AlogP: 7.81#Rotatable Bonds: 3Polar Surface Area: 52.63Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.28CX LogP: 7.24CX LogD: 6.00Aromatic Rings: 4Heavy Atoms: 45QED Weighted: 0.23Np Likeness Score: 1.51
References 1. Schütz R,Müller M,Geisslinger F,Vollmar A,Bartel K,Bracher F. (2020) Synthesis, biological evaluation and toxicity of novel tetrandrine analogues., 207 [PMID:32942071 ] [10.1016/j.ejmech.2020.112810 ] 2. Schütz R,Müller M,Geisslinger F,Vollmar A,Bartel K,Bracher F. (2020) Synthesis, biological evaluation and toxicity of novel tetrandrine analogues., 207 [PMID:32942071 ] [10.1016/j.ejmech.2020.112810 ]