Lycosquarrine B

ID: ALA4779502

PubChem CID: 162663257

Max Phase: Preclinical

Molecular Formula: C25H33NO4

Molecular Weight: 411.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H]1C[C@H]2C[C@H](OC(=O)CCc3ccc(O)cc3)[C@@H]3CCCN4CC[C@H]5O[C@]25[C@]34C1

Standard InChI:  InChI=1S/C25H33NO4/c1-16-13-18-14-21(29-23(28)9-6-17-4-7-19(27)8-5-17)20-3-2-11-26-12-10-22-25(18,30-22)24(20,26)15-16/h4-5,7-8,16,18,20-22,27H,2-3,6,9-15H2,1H3/t16-,18+,20+,21+,22-,24+,25-/m1/s1

Standard InChI Key:  SRCHVEIHBGSEBY-LWISLXJSSA-N

Molfile:  

 
     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
   13.2855   -3.3678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2855   -4.1396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9396   -4.1456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9431   -3.3738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2778   -2.9847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6018   -4.1396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9435   -4.5117    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.9389   -5.2719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5952   -5.6577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2660   -5.2814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2722   -4.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7478   -3.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7684   -2.1049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2802   -2.1263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9454   -2.9799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6023   -3.3661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6071   -2.6019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9311   -4.8990    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.5980   -4.5310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2636   -4.1581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9220   -4.5436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2708   -3.3957    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5958   -4.1707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2542   -4.5561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2438   -5.3202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9014   -5.7138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5679   -5.3326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5728   -4.5621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9146   -4.1801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2234   -5.7259    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3256   -3.6402    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.1984   -1.5194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9806   -2.5713    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1 15  1  0
  2  7  1  0
 16  6  1  0
 16  5  1  0
 11  3  1  0
  3  4  1  0
  4  5  1  0
  6  7  1  0
  6 11  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
  6 12  1  1
 12 13  1  0
  5 14  1  0
 14 13  1  0
 16 15  1  0
 16 17  1  1
 15 17  1  0
 11 18  1  1
  3 19  1  6
 19 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  1  0
 15 31  1  6
 13 32  1  6
  5 33  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4779502

    ---

Associated Targets(non-human)

ACHE Acetylcholinesterase (1035 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 411.54Molecular Weight (Monoisotopic): 411.2410AlogP: 3.68#Rotatable Bonds: 4
Polar Surface Area: 62.30Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.28CX Basic pKa: 9.89CX LogP: 2.91CX LogD: 1.43
Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.60Np Likeness Score: 1.74

References

1. Zhu X,Xia D,Zhou Z,Xie S,Shi Z,Chen G,Wang L,Pan K.  (2020)  Lycosquarrines A-R, Lycopodium Alkaloids from Phlegmariurus squarrosus.,  83  (10): [PMID:32941036] [10.1021/acs.jnatprod.9b00815]

Source