The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Lycosquarrine B ID: ALA4779502
PubChem CID: 162663257
Max Phase: Preclinical
Molecular Formula: C25H33NO4
Molecular Weight: 411.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H]1C[C@H]2C[C@H](OC(=O)CCc3ccc(O)cc3)[C@@H]3CCCN4CC[C@H]5O[C@]25[C@]34C1
Standard InChI: InChI=1S/C25H33NO4/c1-16-13-18-14-21(29-23(28)9-6-17-4-7-19(27)8-5-17)20-3-2-11-26-12-10-22-25(18,30-22)24(20,26)15-16/h4-5,7-8,16,18,20-22,27H,2-3,6,9-15H2,1H3/t16-,18+,20+,21+,22-,24+,25-/m1/s1
Standard InChI Key: SRCHVEIHBGSEBY-LWISLXJSSA-N
Molfile:
RDKit 2D
33 38 0 0 0 0 0 0 0 0999 V2000
13.2855 -3.3678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2855 -4.1396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9396 -4.1456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9431 -3.3738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2778 -2.9847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6018 -4.1396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9435 -4.5117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9389 -5.2719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5952 -5.6577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2660 -5.2814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2722 -4.5152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7478 -3.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7684 -2.1049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2802 -2.1263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9454 -2.9799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6023 -3.3661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6071 -2.6019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9311 -4.8990 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
16.5980 -4.5310 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2636 -4.1581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9220 -4.5436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2708 -3.3957 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5958 -4.1707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2542 -4.5561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2438 -5.3202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9014 -5.7138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5679 -5.3326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5728 -4.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9146 -4.1801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2234 -5.7259 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3256 -3.6402 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.1984 -1.5194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9806 -2.5713 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 15 1 0
2 7 1 0
16 6 1 0
16 5 1 0
11 3 1 0
3 4 1 0
4 5 1 0
6 7 1 0
6 11 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
6 12 1 1
12 13 1 0
5 14 1 0
14 13 1 0
16 15 1 0
16 17 1 1
15 17 1 0
11 18 1 1
3 19 1 6
19 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
15 31 1 6
13 32 1 6
5 33 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 411.54Molecular Weight (Monoisotopic): 411.2410AlogP: 3.68#Rotatable Bonds: 4Polar Surface Area: 62.30Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.28CX Basic pKa: 9.89CX LogP: 2.91CX LogD: 1.43Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.60Np Likeness Score: 1.74
References 1. Zhu X,Xia D,Zhou Z,Xie S,Shi Z,Chen G,Wang L,Pan K. (2020) Lycosquarrines A-R, Lycopodium Alkaloids from Phlegmariurus squarrosus., 83 (10): [PMID:32941036 ] [10.1021/acs.jnatprod.9b00815 ]