7-((4-(4-fluoro-2-methoxyphenyl)pyrimidin-2-yl)amino)-4-morpholino-3-propionyl-2H-chromen-2-one

ID: ALA4779517

PubChem CID: 155677630

Max Phase: Preclinical

Molecular Formula: C27H25FN4O5

Molecular Weight: 504.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC(=O)c1c(N2CCOCC2)c2ccc(Nc3nccc(-c4ccc(F)cc4OC)n3)cc2oc1=O

Standard InChI:  InChI=1S/C27H25FN4O5/c1-3-21(33)24-25(32-10-12-36-13-11-32)19-7-5-17(15-23(19)37-26(24)34)30-27-29-9-8-20(31-27)18-6-4-16(28)14-22(18)35-2/h4-9,14-15H,3,10-13H2,1-2H3,(H,29,30,31)

Standard InChI Key:  FDDRHWAVGSBKFR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   10.7872  -14.0119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7860  -14.8314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4941  -15.2404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2037  -14.8310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2009  -14.0083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4923  -13.6030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4939  -16.0576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7863  -16.4632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7858  -17.2797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4939  -17.6893    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2041  -17.2764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2011  -16.4614    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9131  -17.6827    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6195  -17.2718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3252  -17.6789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3149  -16.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6119  -16.4571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0289  -16.4506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0268  -17.2728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7339  -17.6834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4476  -17.2764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4496  -16.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7380  -16.0390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7389  -15.2218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1537  -17.6877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4532  -14.8150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4561  -14.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7506  -13.5882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0407  -13.9948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0361  -14.8146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9161  -15.2386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6222  -14.8272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1588  -16.0481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8650  -16.4591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1616  -15.2309    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5742  -16.0530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4950  -12.7845    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 11 13  1  0
 13 14  1  0
 14 15  2  0
 15 19  1  0
 18 16  1  0
 16 17  2  0
 17 14  1  0
 18 19  2  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 21 25  2  0
 24 26  1  0
 24 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
  4 31  1  0
 31 32  1  0
 22 33  1  0
 33 34  1  0
 33 35  2  0
 34 36  1  0
  6 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4779517

    ---

Associated Targets(Human)

CCNT1 Tchem CDK9/cyclin T1 (2643 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK2 Tchem CDK2/Cyclin A2 (2260 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 504.52Molecular Weight (Monoisotopic): 504.1809AlogP: 4.57#Rotatable Bonds: 7
Polar Surface Area: 106.79Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.63CX Basic pKa: 1.62CX LogP: 3.82CX LogD: 3.82
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.29Np Likeness Score: -1.13

References

1. Xu J,Li H,Wang X,Huang J,Li S,Liu C,Dong R,Zhu G,Duan C,Jiang F,Zhang Y,Zhu Y,Zhang T,Chen Y,Tang W,Lu T.  (2020)  Discovery of coumarin derivatives as potent and selective cyclin-dependent kinase 9 (CDK9) inhibitors with high antitumour activity.,  200  [PMID:32447197] [10.1016/j.ejmech.2020.112424]

Source