5-chloro-1-methyl-2-(methylthio)-N-(5-nitrothiazol-2-yl)-1H-benzo[d]imidazole-6-carboxamide

ID: ALA4779560

PubChem CID: 162663801

Max Phase: Preclinical

Molecular Formula: C13H10ClN5O3S2

Molecular Weight: 383.84

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CSc1nc2cc(Cl)c(C(=O)Nc3ncc([N+](=O)[O-])s3)cc2n1C

Standard InChI:  InChI=1S/C13H10ClN5O3S2/c1-18-9-3-6(7(14)4-8(9)16-13(18)23-2)11(20)17-12-15-5-10(24-12)19(21)22/h3-5H,1-2H3,(H,15,17,20)

Standard InChI Key:  JIYYKVQJBOLSDC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
    8.9214  -11.5941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0063  -12.4123    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8123  -12.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2248  -11.8688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6716  -11.2565    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2248  -13.2963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0498  -13.2963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4623  -12.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0498  -11.8688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2873  -12.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6998  -13.2963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6998  -11.8688    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0095  -12.5384    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.5247  -11.8688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0095  -11.2034    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7941  -11.4563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7941  -12.2813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4637  -12.7660    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3789  -13.5884    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2181  -12.4326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2056  -11.1816    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.4897  -11.5941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8441  -10.4505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4623  -14.0122    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  1  5  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  4  9  2  0
  3  6  2  0
 10 11  2  0
 10 12  1  0
  8 10  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 13 17  1  0
 18 19  2  0
 18 20  1  0
 17 18  1  0
 12 14  1  0
 21 22  1  0
  1 21  1  0
  5 23  1  0
  7 24  1  0
M  CHG  2  18   1  20  -1
M  END

Alternative Forms

  1. Parent:

    ALA4779560

    ---

Associated Targets(non-human)

Giardia intestinalis (1290 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 383.84Molecular Weight (Monoisotopic): 382.9914AlogP: 3.57#Rotatable Bonds: 4
Polar Surface Area: 102.95Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.08CX Basic pKa: 3.44CX LogP: 3.94CX LogD: 3.94
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.42Np Likeness Score: -2.69

References

1. Riches A,Hart CJS,Trenholme KR,Skinner-Adams TS.  (2020)  Anti-Giardia Drug Discovery: Current Status and Gut Feelings.,  63  (22.0): [PMID:32869995] [10.1021/acs.jmedchem.0c00910]

Source