The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-chloro-1-methyl-2-(methylthio)-N-(5-nitrothiazol-2-yl)-1H-benzo[d]imidazole-6-carboxamide ID: ALA4779560
PubChem CID: 162663801
Max Phase: Preclinical
Molecular Formula: C13H10ClN5O3S2
Molecular Weight: 383.84
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CSc1nc2cc(Cl)c(C(=O)Nc3ncc([N+](=O)[O-])s3)cc2n1C
Standard InChI: InChI=1S/C13H10ClN5O3S2/c1-18-9-3-6(7(14)4-8(9)16-13(18)23-2)11(20)17-12-15-5-10(24-12)19(21)22/h3-5H,1-2H3,(H,15,17,20)
Standard InChI Key: JIYYKVQJBOLSDC-UHFFFAOYSA-N
Molfile:
RDKit 2D
24 26 0 0 0 0 0 0 0 0999 V2000
8.9214 -11.5941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0063 -12.4123 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8123 -12.5847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2248 -11.8688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6716 -11.2565 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2248 -13.2963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0498 -13.2963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4623 -12.5847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0498 -11.8688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2873 -12.5847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6998 -13.2963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6998 -11.8688 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0095 -12.5384 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.5247 -11.8688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0095 -11.2034 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7941 -11.4563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7941 -12.2813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4637 -12.7660 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3789 -13.5884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2181 -12.4326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2056 -11.1816 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.4897 -11.5941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8441 -10.4505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4623 -14.0122 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 1 0
1 5 1 0
6 7 1 0
7 8 2 0
8 9 1 0
4 9 2 0
3 6 2 0
10 11 2 0
10 12 1 0
8 10 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
13 17 1 0
18 19 2 0
18 20 1 0
17 18 1 0
12 14 1 0
21 22 1 0
1 21 1 0
5 23 1 0
7 24 1 0
M CHG 2 18 1 20 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 383.84Molecular Weight (Monoisotopic): 382.9914AlogP: 3.57#Rotatable Bonds: 4Polar Surface Area: 102.95Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.08CX Basic pKa: 3.44CX LogP: 3.94CX LogD: 3.94Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.42Np Likeness Score: -2.69