N-(3-(diethylamino)propyl)-1-ethyl-4-(3-(4-(3-ethyl-3-hydroxypentyloxy)-3-methylphenyl)pentan-3-yl)-1H-pyrrole-2-carboxamide

ID: ALA4779563

PubChem CID: 162663803

Max Phase: Preclinical

Molecular Formula: C33H55N3O3

Molecular Weight: 541.82

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(CC)CCCNC(=O)c1cc(C(CC)(CC)c2ccc(OCCC(O)(CC)CC)c(C)c2)cn1CC

Standard InChI:  InChI=1S/C33H55N3O3/c1-9-32(38,10-2)19-22-39-30-18-17-27(23-26(30)8)33(11-3,12-4)28-24-29(36(15-7)25-28)31(37)34-20-16-21-35(13-5)14-6/h17-18,23-25,38H,9-16,19-22H2,1-8H3,(H,34,37)

Standard InChI Key:  GCHKIPGAZRMDLJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 40  0  0  0  0  0  0  0  0999 V2000
   16.1747  -19.9538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5913  -20.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0036  -19.9512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4523  -19.8454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4512  -20.6728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1660  -21.0857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8824  -20.6723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8795  -19.8418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1642  -19.4326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1658  -21.9105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7364  -21.0846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.5924  -19.4266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3085  -19.8364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4015  -20.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2091  -20.8239    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.6189  -20.1078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0644  -19.4970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4409  -20.0184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9285  -20.6839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.7736  -19.2634    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0038  -18.8371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1745  -18.8371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0444  -18.0416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0410  -18.0699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5937  -19.1740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9264  -18.4191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0223  -20.6716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3075  -21.0835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5475  -21.5763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0651  -22.2455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7465  -18.3297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0792  -17.5747    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.8993  -17.4854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5917  -16.9092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9243  -16.1543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2320  -16.7304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8786  -21.0824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.8286  -19.9487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5850  -19.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  6 10  1  0
  5 11  1  0
  8 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 13  1  0
 18 19  2  0
 18 20  1  0
 16 18  1  0
 12 21  1  0
 12 22  1  0
 22 23  1  0
 21 24  1  0
 20 25  1  0
 25 26  1  0
 11 27  1  0
 27 28  1  0
 28  2  1  0
 15 29  1  0
 29 30  1  0
 26 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  1  0
 34 35  1  0
 33 36  1  0
  2 37  1  0
  3 38  1  0
  1 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4779563

    ---

Associated Targets(Human)

VDR Tclin Vitamin D receptor (26531 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 541.82Molecular Weight (Monoisotopic): 541.4243AlogP: 6.70#Rotatable Bonds: 18
Polar Surface Area: 66.73Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.84CX LogP: 6.46CX LogD: 4.05
Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.21Np Likeness Score: -0.76

References

1. Kang Z,Wang C,Tong Y,Li Y,Gao Y,Hou S,Hao M,Han X,Wang B,Wang Q,Zhang C.  (2021)  Novel Nonsecosteroidal Vitamin D Receptor Modulator Combined with Gemcitabine Enhances Pancreatic Cancer Therapy through Remodeling of the Tumor Microenvironment.,  64  (1.0): [PMID:33381963] [10.1021/acs.jmedchem.0c01197]

Source