The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(1-(2-methoxyethyl)-1H-indol-3-yl)-N-((S)-piperidin-3-yl)-5-(trifluoromethyl)pyrimidin-2-amine ID: ALA4779588
PubChem CID: 162662821
Max Phase: Preclinical
Molecular Formula: C21H24F3N5O
Molecular Weight: 419.45
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCn1cc(-c2nc(N[C@H]3CCCNC3)ncc2C(F)(F)F)c2ccccc21
Standard InChI: InChI=1S/C21H24F3N5O/c1-30-10-9-29-13-16(15-6-2-3-7-18(15)29)19-17(21(22,23)24)12-26-20(28-19)27-14-5-4-8-25-11-14/h2-3,6-7,12-14,25H,4-5,8-11H2,1H3,(H,26,27,28)/t14-/m0/s1
Standard InChI Key: QMZHENYYIFYXKE-AWEZNQCLSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
34.5451 -19.4244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5440 -20.2513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2584 -20.6640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2567 -19.0118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9717 -19.4207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9766 -20.2468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7637 -20.4974 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.2454 -19.8263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7559 -19.1609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0065 -18.3789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8134 -18.2038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0638 -17.4189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5082 -16.8084 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.6990 -16.9880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4525 -17.7727 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.0230 -21.2802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8306 -21.4470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0900 -22.2297 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.8976 -22.3965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3682 -18.8139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1172 -19.5994 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.9486 -18.2250 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
39.0778 -19.2245 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
36.1415 -16.3805 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.3365 -16.5595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7824 -15.9481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9806 -16.1244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7289 -16.9101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2856 -17.5197 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.0939 -17.3437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
9 10 1 0
7 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
11 20 1 0
20 21 1 0
20 22 1 0
20 23 1 0
14 24 1 0
25 24 1 6
25 26 1 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.45Molecular Weight (Monoisotopic): 419.1933AlogP: 3.93#Rotatable Bonds: 6Polar Surface Area: 64.00Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.40CX LogP: 3.49CX LogD: 1.51Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.63Np Likeness Score: -1.28
References 1. (2019) Inhibitors of cyclin-dependent kinase 7 (cdk7),