The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Acetyl-4-(4-ethylpiperazin-1-yl)-7-((5-fluoro-4-(4-fluoro-2-methoxyphenyl)pyrimidin-2-yl)amino)-2H-chromen-2-one ID: ALA4779614
PubChem CID: 162662953
Max Phase: Preclinical
Molecular Formula: C28H27F2N5O4
Molecular Weight: 535.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN1CCN(c2c(C(C)=O)c(=O)oc3cc(Nc4ncc(F)c(-c5ccc(F)cc5OC)n4)ccc23)CC1
Standard InChI: InChI=1S/C28H27F2N5O4/c1-4-34-9-11-35(12-10-34)26-20-8-6-18(14-23(20)39-27(37)24(26)16(2)36)32-28-31-15-21(30)25(33-28)19-7-5-17(29)13-22(19)38-3/h5-8,13-15H,4,9-12H2,1-3H3,(H,31,32,33)
Standard InChI Key: FENPXPBUKNHHHM-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
10.5478 -20.2935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5466 -21.1131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2547 -21.5220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9643 -21.1126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9615 -20.2899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2529 -19.8847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2545 -22.3392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5469 -22.7449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5464 -23.5613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2545 -23.9709 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9647 -23.5581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9617 -22.7430 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6737 -23.9644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3801 -23.5534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0859 -23.9606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0755 -22.3262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3725 -22.7388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7895 -22.7323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7875 -23.5545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4945 -23.9651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2082 -23.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2103 -22.7358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4986 -22.3207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4995 -21.5035 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9143 -23.9693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2138 -21.0967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2167 -20.2831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5112 -19.8699 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8013 -20.2765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7967 -21.0962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6767 -21.5202 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3828 -21.1089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9194 -22.3297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6257 -22.7408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9223 -21.5125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2556 -19.0661 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.8418 -22.3331 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.5152 -19.0527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2249 -18.6475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
11 13 1 0
13 14 1 0
14 15 2 0
15 19 1 0
18 16 1 0
16 17 2 0
17 14 1 0
18 19 2 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
21 25 2 0
24 26 1 0
24 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
4 31 1 0
31 32 1 0
22 33 1 0
33 34 1 0
33 35 2 0
6 36 1 0
8 37 1 0
28 38 1 0
38 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 535.55Molecular Weight (Monoisotopic): 535.2031AlogP: 4.62#Rotatable Bonds: 7Polar Surface Area: 100.80Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.97CX Basic pKa: 6.79CX LogP: 3.69CX LogD: 3.59Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.27Np Likeness Score: -1.11
References 1. Xu J,Li H,Wang X,Huang J,Li S,Liu C,Dong R,Zhu G,Duan C,Jiang F,Zhang Y,Zhu Y,Zhang T,Chen Y,Tang W,Lu T. (2020) Discovery of coumarin derivatives as potent and selective cyclin-dependent kinase 9 (CDK9) inhibitors with high antitumour activity., 200 [PMID:32447197 ] [10.1016/j.ejmech.2020.112424 ]