The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(1-acryloyl-2,3,6,7-tetrahydro-1H-azepin-4-yl)phenyl)-N-(5-cyclopropyl-1H-pyrazol-3-yl)propanamide ID: ALA4779633
PubChem CID: 139558746
Max Phase: Preclinical
Molecular Formula: C24H28N4O2
Molecular Weight: 404.51
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)N1CCC=C(c2ccc(C(C)C(=O)Nc3cc(C4CC4)[nH]n3)cc2)CC1
Standard InChI: InChI=1S/C24H28N4O2/c1-3-23(29)28-13-4-5-18(12-14-28)19-8-6-17(7-9-19)16(2)24(30)25-22-15-21(26-27-22)20-10-11-20/h3,5-9,15-16,20H,1,4,10-14H2,2H3,(H2,25,26,27,30)
Standard InChI Key: VFRSDNYJPASDOG-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
9.8792 -6.6572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8780 -7.4767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5861 -7.8857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2957 -7.4762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2929 -6.6536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5843 -6.2483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9991 -6.2423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7083 -6.6482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9960 -5.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7114 -7.4654 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4145 -6.2370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1237 -6.6429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2146 -7.4546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0145 -7.6215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4205 -6.9122 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8713 -6.3071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3508 -8.3663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2684 -9.1793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0137 -8.8441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1713 -7.8864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2339 -8.6955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6359 -9.2547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4949 -7.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8284 -9.1393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7139 -7.6697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4202 -8.4330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6055 -8.4970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1428 -7.8235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2536 -9.2345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4389 -9.2985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 1 0
8 10 2 0
8 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 12 2 0
18 17 1 0
19 18 1 0
17 19 1 0
14 17 1 0
2 20 1 0
20 21 2 0
21 22 1 0
20 23 1 0
22 24 1 0
23 25 1 0
24 26 1 0
25 26 1 0
26 27 1 0
27 28 2 0
27 29 1 0
29 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 404.51Molecular Weight (Monoisotopic): 404.2212AlogP: 4.22#Rotatable Bonds: 6Polar Surface Area: 78.09Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.26CX Basic pKa: 2.00CX LogP: 3.76CX LogD: 3.76Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.71Np Likeness Score: -0.65
References 1. (2019) Substituted Pyrazole Derivatives As Selective CDK12/13 Inhibitors,