The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((S)-1-methylpiperidin-3-yl)-4-(6-(methylsulfonyl)-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-amine ID: ALA4779648
PubChem CID: 145444347
Max Phase: Preclinical
Molecular Formula: C20H22F3N5O2S
Molecular Weight: 453.49
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCC[C@H](Nc2ncc(C(F)(F)F)c(-c3c[nH]c4cc(S(C)(=O)=O)ccc34)n2)C1
Standard InChI: InChI=1S/C20H22F3N5O2S/c1-28-7-3-4-12(11-28)26-19-25-10-16(20(21,22)23)18(27-19)15-9-24-17-8-13(31(2,29)30)5-6-14(15)17/h5-6,8-10,12,24H,3-4,7,11H2,1-2H3,(H,25,26,27)/t12-/m0/s1
Standard InChI Key: IVBPBUTZXUYNRK-LBPRGKRZSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
16.2407 -6.7677 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8329 -6.0559 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.4204 -6.7651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5515 -4.8198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5503 -5.6462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2644 -6.0587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2626 -4.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9772 -4.8161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9820 -5.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7686 -5.8923 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2501 -5.2214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7609 -4.5564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0114 -3.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8178 -3.5999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0679 -2.8155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5127 -2.2054 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7040 -2.3850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4576 -3.1692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1468 -1.7777 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3424 -1.9566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7856 -1.3423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9842 -1.5185 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7328 -2.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2891 -2.9129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0969 -2.7371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4293 -0.9092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3722 -4.2097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1214 -4.9947 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.9524 -3.6211 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.0813 -4.6200 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.1229 -5.6451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
12 13 1 0
17 19 1 0
20 19 1 1
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
22 26 1 0
14 27 1 0
27 28 1 0
27 29 1 0
27 30 1 0
5 2 1 0
2 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.49Molecular Weight (Monoisotopic): 453.1446AlogP: 3.55#Rotatable Bonds: 4Polar Surface Area: 90.98Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.12CX Basic pKa: 8.29CX LogP: 2.54CX LogD: 1.59Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.63Np Likeness Score: -1.26
References 1. (2019) Inhibitors of cyclin-dependent kinase 7 (cdk7),