The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-ethyl-4-(3-(4-(2-hydroxypropoxy)-3-methylphenyl)pentan-3-yl)-N-((tetrahydro-2H-pyran-4-yl)methyl)-1H-pyrrole-2-carboxamide ID: ALA4779729
PubChem CID: 162662392
Max Phase: Preclinical
Molecular Formula: C28H42N2O4
Molecular Weight: 470.65
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCn1cc(C(CC)(CC)c2ccc(OCC(C)O)c(C)c2)cc1C(=O)NCC1CCOCC1
Standard InChI: InChI=1S/C28H42N2O4/c1-6-28(7-2,23-9-10-26(20(4)15-23)34-19-21(5)31)24-16-25(30(8-3)18-24)27(32)29-17-22-11-13-33-14-12-22/h9-10,15-16,18,21-22,31H,6-8,11-14,17,19H2,1-5H3,(H,29,32)
Standard InChI Key: AIOGCIZSTAZIIJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
34.2247 -11.0248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.0856 -10.1998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0845 -11.0273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7993 -11.4401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5157 -11.0268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5129 -10.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7976 -9.7871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7991 -12.2651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3698 -11.4392 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.2258 -9.7811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9418 -10.1908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0348 -11.0099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8424 -11.1784 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.2522 -10.4623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6979 -9.8514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0743 -10.3728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5618 -11.0384 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.4069 -9.6178 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.6371 -9.1916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8079 -9.1916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6778 -8.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7333 -8.3359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2271 -9.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5597 -8.7735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6556 -11.0260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9408 -11.4380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1808 -11.9308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6985 -12.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9406 -12.2630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3783 -8.6883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7112 -7.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2270 -7.2691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.4057 -7.3567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0687 -8.1126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
4 8 1 0
3 9 1 0
6 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 11 1 0
16 17 2 0
16 18 1 0
14 16 1 0
10 19 1 0
10 20 1 0
20 21 1 0
19 22 1 0
18 23 1 0
23 24 1 0
9 25 1 0
25 26 1 0
26 1 1 0
13 27 1 0
27 28 1 0
26 29 1 0
24 30 1 0
24 34 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.65Molecular Weight (Monoisotopic): 470.3145AlogP: 4.84#Rotatable Bonds: 11Polar Surface Area: 72.72Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.70CX LogD: 4.70Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.49Np Likeness Score: -0.68
References 1. Kang Z,Wang C,Tong Y,Li Y,Gao Y,Hou S,Hao M,Han X,Wang B,Wang Q,Zhang C. (2021) Novel Nonsecosteroidal Vitamin D Receptor Modulator Combined with Gemcitabine Enhances Pancreatic Cancer Therapy through Remodeling of the Tumor Microenvironment., 64 (1.0): [PMID:33381963 ] [10.1021/acs.jmedchem.0c01197 ]