The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-N-(2-(Diethylamino)ethyl)-5-((5-(2-(dimethylamino)ethyl)-2-oxoindolin-3-ylidene)methyl)-2,4-dimethyl-1H-pyrrole-3-carboxamide ID: ALA4779730
PubChem CID: 162662393
Max Phase: Preclinical
Molecular Formula: C26H37N5O2
Molecular Weight: 451.62
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCNC(=O)c1c(C)[nH]c(/C=C2\C(=O)Nc3ccc(CCN(C)C)cc32)c1C
Standard InChI: InChI=1S/C26H37N5O2/c1-7-31(8-2)14-12-27-26(33)24-17(3)23(28-18(24)4)16-21-20-15-19(11-13-30(5)6)9-10-22(20)29-25(21)32/h9-10,15-16,28H,7-8,11-14H2,1-6H3,(H,27,33)(H,29,32)/b21-16-
Standard InChI Key: VBPDEHRSGBYGIY-PGMHBOJBSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
12.6358 -12.0371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6346 -12.8645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3494 -13.2773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3476 -11.6244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0629 -12.0335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0632 -12.8645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8536 -13.1212 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3419 -12.4486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8532 -11.7766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1079 -10.9919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1669 -12.4483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9154 -10.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4670 -11.4330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2189 -11.0973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1321 -10.2784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3265 -10.1081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9901 -9.3548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7446 -9.7258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5294 -9.9799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5722 -8.9190 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9338 -11.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1420 -9.4273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9268 -9.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5393 -9.1287 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.3242 -9.3829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9367 -8.8301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3669 -8.3220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9794 -7.7692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9178 -11.6230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9174 -10.7980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6317 -10.3852 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3464 -10.7974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6313 -9.5602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
9 10 2 0
10 12 1 0
8 11 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 2 0
16 17 1 0
15 18 1 0
18 19 1 0
18 20 2 0
14 21 1 0
19 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
27 28 1 0
1 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
31 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.62Molecular Weight (Monoisotopic): 451.2947AlogP: 3.30#Rotatable Bonds: 10Polar Surface Area: 80.47Molecular Species: BASEHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.47CX Basic pKa: 9.38CX LogP: 3.01CX LogD: -0.35Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.48Np Likeness Score: -0.75
References 1. Matheson CJ,Casalvieri KA,Backos DS,Minhajuddin M,Jordan CT,Reigan P. (2020) Substituted oxindol-3-ylidenes as AMP-activated protein kinase (AMPK) inhibitors., 197 [PMID:32334266 ] [10.1016/j.ejmech.2020.112316 ]