The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4779743
PubChem CID: 162662402
Max Phase: Preclinical
Molecular Formula: C31H36O7
Molecular Weight: 520.62
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(c(OC)c1OC)-c1c(cc(C)c(C)c1OC)[C@@H](C(=O)Oc1ccccc1)[C@@](C)(O)[C@@H](C)C2
Standard InChI: InChI=1S/C31H36O7/c1-17-14-22-25(27(35-6)19(17)3)24-20(16-23(34-5)28(36-7)29(24)37-8)15-18(2)31(4,33)26(22)30(32)38-21-12-10-9-11-13-21/h9-14,16,18,26,33H,15H2,1-8H3/t18-,26-,31-/m0/s1
Standard InChI Key: AAFSWZVIMJNAQQ-HBMMOJBUSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
15.7040 -10.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8785 -10.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2913 -11.3329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2949 -9.2089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8796 -9.7937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2949 -11.1997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8882 -9.7947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4695 -9.2089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2523 -8.4146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4542 -8.2052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8737 -8.7961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0939 -9.5881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4721 -11.2004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8888 -10.6191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0959 -10.8341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8851 -11.6299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4733 -12.2106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2641 -11.9925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6105 -11.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1077 -12.6172 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4288 -12.0705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7444 -12.8332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2407 -13.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5557 -14.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3749 -14.3573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8781 -13.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5604 -12.9382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6425 -9.4784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2352 -7.4093 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8148 -6.8217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0744 -8.5896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8536 -7.7943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2683 -9.5800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8626 -8.8611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5105 -10.2522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7138 -10.4681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0887 -11.8473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2653 -13.0094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
3 2 1 0
8 4 1 0
4 5 1 0
5 2 1 0
2 6 1 0
6 13 1 0
14 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
6 19 1 6
19 20 2 0
19 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
5 28 1 6
10 29 1 0
29 30 1 0
11 31 1 0
31 32 1 0
12 33 1 0
33 34 1 0
15 35 1 0
35 36 1 0
16 37 1 0
17 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 520.62Molecular Weight (Monoisotopic): 520.2461AlogP: 5.64#Rotatable Bonds: 6Polar Surface Area: 83.45Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.91CX LogD: 5.91Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.33Np Likeness Score: 1.01
References 1. Nguyen T,Marusich J,Li JX,Zhang Y. (2020) Neuropeptide FF and Its Receptors: Therapeutic Applications and Ligand Development., 63 (21.0): [PMID:32673481 ] [10.1021/acs.jmedchem.0c00643 ]